Calcitriol/ja: Difference between revisions
Calcitriol/ja
Created page with "<!-- Legal status --> | legal_AU = S4 | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> | legal_BR_comment = | legal_CA = Rx-only | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = POM | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU..." Tags: Mobile edit Mobile web edit |
Created page with "<!-- Chemical and physical data --> | IUPAC_name = (1''R'',3''S'')-5-[2-[(1''R'',3a''R'',7a''S'')-1-[(2''R'')-6-hydroxy-6-methyl-heptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''- inden-4-ylidene]ethylidene]-4-methylidene-cyclohexane-1,3-diol | C=27 | H=44 | O=3 | SMILES = C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C27H44O3/c1-18(8-6-14-26(3,4)30)23-12-13-24-20..." Tags: Mobile edit Mobile web edit |
||
| Line 47: | Line 47: | ||
| legal_status = <!-- For countries not listed above --> | | legal_status = <!-- For countries not listed above --> | ||
<!-- Pharmacokinetic data --> | <!-- Pharmacokinetic data --> | ||
| bioavailability = | | bioavailability = | ||
| Line 54: | Line 53: | ||
| metabolites = | | metabolites = | ||
| onset = | | onset = | ||
| elimination_half-life = | | elimination_half-life = 5～8時間（大人）、27時間（子供） | ||
| duration_of_action = | | duration_of_action = | ||
| excretion = | | excretion = 糞便（50％）、尿（16％） | ||
<!-- Identifiers --> | <!-- Identifiers --> | ||
| CAS_number_Ref = {{cascite|correct|??}} | | CAS_number_Ref = {{cascite|correct|??}} | ||
| Line 80: | Line 77: | ||
| PDB_ligand = VDX | | PDB_ligand = VDX | ||
| synonyms = 1,25-dihydroxycholecalciferol, 1alpha,25-dihydroxyvitamin D3, 1,25-dihydroxyvitamin D<sub>3</sub>, 1α,25-(OH)<sub>2</sub>D<sub>3</sub>, 1,25(OH)<sub>2</sub>D | | synonyms = 1,25-dihydroxycholecalciferol, 1alpha,25-dihydroxyvitamin D3, 1,25-dihydroxyvitamin D<sub>3</sub>, 1α,25-(OH)<sub>2</sub>D<sub>3</sub>, 1,25(OH)<sub>2</sub>D | ||
<!-- Chemical and physical data --> | <!-- Chemical and physical data --> | ||
| IUPAC_name = (1''R'',3''S'')-5-[2-[(1''R'',3a''R'',7a''S'')-1-[(2''R'')-6-hydroxy-6-methyl-heptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''- inden-4-ylidene]ethylidene]-4-methylidene-cyclohexane-1,3-diol | | IUPAC_name = (1''R'',3''S'')-5-[2-[(1''R'',3a''R'',7a''S'')-1-[(2''R'')-6-hydroxy-6-methyl-heptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1''H''- inden-4-ylidene]ethylidene]-4-methylidene-cyclohexane-1,3-diol | ||
| Line 103: | Line 98: | ||
| specific_rotation = | | specific_rotation = | ||
}} | }} | ||
<div lang="en" dir="ltr" class="mw-content-ltr"> | <div lang="en" dir="ltr" class="mw-content-ltr"> | ||