Ethyl eicosapentaenoic acid/ja: Difference between revisions
Ethyl eicosapentaenoic acid/ja
Created page with "<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =" |
Created page with "<!-- Chemical and physical data --> | IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment..." Tags: Mobile edit Mobile web edit |
||
| Line 86: | Line 86: | ||
| synonyms = Eicosapentaenoic acid ethyl ester; Ethyl eicosapentaenoate; Eicosapent; EPA ethyl ester; E-EPA | | synonyms = Eicosapentaenoic acid ethyl ester; Ethyl eicosapentaenoate; Eicosapent; EPA ethyl ester; E-EPA | ||
<!-- Chemical and physical data --> | <!-- Chemical and physical data --> | ||
| IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | | IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | ||
| Line 107: | Line 106: | ||
| specific_rotation = | | specific_rotation = | ||
}} | }} | ||
<div lang="en" dir="ltr" class="mw-content-ltr"> | <div lang="en" dir="ltr" class="mw-content-ltr"> | ||