Translations:Pantothenic acid/1/ja: Difference between revisions

Pantothenic acid/1/ja
Names
	Preferred IUPAC name 3-[(2R)-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid
	Systematic IUPAC name 3-[(2R)-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
Identifiers
CAS Number	599-54-2 ; 79-83-4 (R) ;
3D model (JSmol)	Interactive image; (R): Interactive image; (S): Interactive image;
3DMet	B00193;
Beilstein Reference	1727062, 1727064 (R)
ChEBI	CHEBI:7916 ;
ChEMBL	ChEMBL1594 ;
ChemSpider	963 ; 6361 (R) ; 4677898 (S) ;
DrugBank	DB01783 ;
EC Number	209-965-4;
KEGG	D07413 ;
MeSH	Pantothenic+Acid
PubChem CID	988; 6613 (R); 5748353 (S);
RTECS number	RU4729000;
UNII	66Y94D1203 ; 19F5HK2737 (R) ;
	InChI InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) Key: GHOKWGTUZJEAQD-UHFFFAOYSA-N ;
	SMILES CC(C)(CO)C(C(=O)NCCC(=O)O)O; (R): CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O; (S): CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O;
Properties
Chemical formula	C9H17NO5
Molar mass	219.237 g·mol−1
Appearance	Yellow oil; Colorless crystals (Ca2+ salt)
Odor	Odorless
Density	1.266 g/cm3; 1.32 g/cm3 (Ca2+ salt)
Melting point	183.833 °C (362.899 °F; 456.983 K) ; 196–200 °C (385–392 °F; 469–473 K); decomposes (Ca2+ salt)
Solubility in water	Very soluble
Solubility	Very soluble in C6H6, ether
log P	−1.416
Acidity (pKa)	4.41
Basicity (pKb)	9.698
Chiral rotation ([α]D)	+37.5°; +24.3° (Ca2+ salt)
Hazards
NFPA 704 (fire diamond)	2 1 0
	Lethal dose or concentration (LD, LC):
LD50 (median dose)	> 10 mg/g (Ca2+ salt)
Related compounds
Related alkanoic acids	Arginine/ja; Hopantenic acid/ja; 4-(γ-Glutamylamino)butanoic acid/ja
Related compounds	パンテノール

VisualWikitext

Latest revision as of 16:49, 20 February 2024

Information about message (contribute)

This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.

Message definition (Pantothenic acid)

{{Short description|chemical compound}}
{{Pathnav|Dietary supplement|Vitamin|frame=1}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477003091
| ImageFile = (R)-Pantothenic acid Formula V.1.svg
| ImageSize =
| ImageName = Skeletal formula of (R)-pantothenic acid
| ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png
| ImageSize1 =
| ImageName1 = Pantothenic acid molecule
| PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid
| SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
|Section1={{Chembox Identifiers
| CASNo = 599-54-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 79-83-4
| CASNo1_Comment = (''R'')
| CASNo1_Ref = {{cascite|correct|CAS}}
| PubChem = 988
| PubChem1 = 6613
| PubChem1_Comment = (''R'')
| PubChem2 = 5748353
| PubChem2_Comment = (''S'')
| ChemSpiderID = 963
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 6361
| ChemSpiderID1_Comment = (''R'')
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID2 = 4677898
| ChemSpiderID2_Comment = (''S'')
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 66Y94D1203
| UNII1 = 19F5HK2737
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1_Comment = (''R'')
| EC_number = 209-965-4
| DrugBank = DB01783
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D07413
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Pantothenic+Acid
| ChEBI = 7916
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1594
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1727062, 1727064 (''R'')
| 3DMet = B00193
| SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O
| SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O
| SMILES1_Comment = (''R'')
| SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O
| SMILES2_Comment = (''S'')
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| RTECS = RU4729000
}}
|Section2={{Chembox Properties
| C=9 | H=17 | N=1 | O=5
| Density = 1.266 g/cm3 1.32 g/cm3 (Ca2+ salt)
| Appearance = Yellow oil Colorless crystals (Ca2+ salt)
| Odor = Odorless
| MeltingPtC = 183.833
| MeltingPt_notes = {{convert|196-200|C|F K}} decomposes (Ca2+ salt)
| LogP = −1.416
| pKa = 4.41
| pKb = 9.698
| Solubility = Very soluble
| SolubleOther = Very soluble in [[benzene|C6H6]], [[diethyl ether|ether]]
| SpecRotation = +37.5° +24.3° (Ca2+ salt)
}}
|Section7={{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| LD50 = > 10 mg/g (Ca2+ salt)
}}
|Section9={{Chembox Related
| OtherFunction_label = alkanoic acids
| OtherFunction = [[Arginine]] [[Hopantenic acid]] [[4-(γ-Glutamylamino)butanoic acid]]
| OtherCompounds = [[Panthenol]]
}}
}}

Dietary supplement/ja > Vitamin/ja > Pantothenic acid/1/ja

Translations:Pantothenic acid/1/ja: Difference between revisions

Latest revision as of 16:49, 20 February 2024

Navigation menu

Search