Translations:Cholecalciferol/6/en

From Azupedia
Jump to navigation Jump to search

| IUPAC_name = (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol | C=27|H=44|O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C | StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 | StdInChI_Ref =  ☒N | StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N | density = | density_notes = | melting_point = 83 to 86 | melting_high = | melting_notes = | boiling_point = 496.4 | boiling_notes = | solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils. | sol_units = | specific_rotation = }}