Translations:Ethyl eicosapentaenoic acid/6/ja

From Azupedia
Revision as of 19:17, 15 April 2024 by Fire (talk | contribs) (Created page with "<!-- Chemical and physical data --> | IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment...")
(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Jump to navigation Jump to search

| IUPAC_name = Ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref =  ☒N | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment = | StdInChIKey_Ref =  ☒N | StdInChIKey = SSQPWTVBQMWLSZ-AAQCHOMXSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}