Translations:Allithiamine/5/ja

From Azupedia
Revision as of 08:31, 3 April 2024 by Fire (talk | contribs) (Created page with "<!--Chemical data--> | C=15 | H=22 | N=4 | O=2 | S=2 | smiles = O=CN(/C(=C(\SSC\C=C)CCO)C)Cc1cnc(nc1N)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WNCAVNGLACHSRZ-KAMYIIQDSA-N }}")
(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Jump to navigation Jump to search

| C=15 | H=22 | N=4 | O=2 | S=2 | smiles = O=CN(/C(=C(\SSC\C=C)CCO)C)Cc1cnc(nc1N)C | StdInChI_Ref =  checkY | StdInChI = 1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- | StdInChIKey_Ref =  checkY | StdInChIKey = WNCAVNGLACHSRZ-KAMYIIQDSA-N }}