Losartan/ja: Difference between revisions
Losartan/ja
Created page with "<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P,..." Tags: Mobile edit Mobile web edit |
Created page with "<!-- Chemical and physical data --> | IUPAC_name = (2-butyl-4-chloro-1-{[2'-(2''H''-tetrazol-5-yl)biphenyl-4-yl]methyl}-1''H''-imidazol-5-yl)methanol | C=22 | H=23 | Cl=1 | N=6 | O=1 | SMILES = CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) | StdIn..." Tags: Mobile edit Mobile web edit |
||
| Line 47: | Line 47: | ||
| legal_status = Rx-only | | legal_status = Rx-only | ||
<!-- Pharmacokinetic data --> | <!-- Pharmacokinetic data --> | ||
| bioavailability = 25–35% | | bioavailability = 25–35% | ||
| protein_bound = 99.7% ( | | protein_bound = 99.7% (主に[[albumin/ja|アルブミン]]) | ||
| metabolism = [[Liver]] ([[CYP2C9]], [[CYP3A4]]) | | metabolism = [[Liver/ja]] ([[CYP2C9/ja]], [[CYP3A4/ja]]) | ||
| metabolites = | | metabolites = | ||
| onset = | | onset = | ||
| elimination_half-life = 1. | | elimination_half-life = 1.5–2時間 | ||
| duration_of_action = | | duration_of_action = | ||
| excretion = [[Kidney]] 13–25%, [[bile duct]] 50–60% | | excretion = [[Kidney/ja]] 13–25%, [[bile duct/ja]] 50–60% | ||
<!-- Identifiers --> | <!-- Identifiers --> | ||
| CAS_number_Ref = {{cascite|correct|??}} | | CAS_number_Ref = {{cascite|correct|??}} | ||
| Line 80: | Line 77: | ||
| NIAID_ChemDB = | | NIAID_ChemDB = | ||
| PDB_ligand = | | PDB_ligand = | ||
| synonyms = | | synonyms = | ||
<!-- Chemical and physical data --> | <!-- Chemical and physical data --> | ||
| IUPAC_name = (2-butyl-4-chloro-1-{[2'-(2''H''-tetrazol-5-yl)biphenyl-4-yl]methyl}-1''H''-imidazol-5-yl)methanol | | IUPAC_name = (2-butyl-4-chloro-1-{[2'-(2''H''-tetrazol-5-yl)biphenyl-4-yl]methyl}-1''H''-imidazol-5-yl)methanol | ||
| Line 104: | Line 99: | ||
| specific_rotation = | | specific_rotation = | ||
}} | }} | ||
<div lang="en" dir="ltr" class="mw-content-ltr"> | <div lang="en" dir="ltr" class="mw-content-ltr"> | ||