Translations:Febuxostat/6/ja: Difference between revisions
Jump to navigation
Jump to search
Created page with "<!-- Chemical data --> | IUPAC_name = 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-<br />1,3-thiazole-5-carboxylic acid | C=16 | H=16 | N=2 | Na= | O=3 | S=1 | smiles = N#Cc1c(OCC(C)C)ccc(c1)c2nc(c(s2)C(=O)O)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BQSJTQLCZDPROO-UHFFFAOYS..." |
(No difference)
|
Latest revision as of 20:21, 22 April 2024
| IUPAC_name = 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-
1,3-thiazole-5-carboxylic acid
| C=16 | H=16 | N=2 | Na= | O=3 | S=1
| smiles = N#Cc1c(OCC(C)C)ccc(c1)c2nc(c(s2)C(=O)O)C
| StdInChI_Ref =
| StdInChI = 1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20)
| StdInChIKey_Ref =
| StdInChIKey = BQSJTQLCZDPROO-UHFFFAOYSA-N
}}