Translations:Alfacalcidol/1/ja: Difference between revisions

Alfacalcidol/1/ja
Names
	Preferred IUPAC name (1R,3S,5Z)-4-Methylidene-5-[(2E)-2-{(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]octahydro-4H-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol
	Other names Alphacalcidol; 1-Hydroxycholecalciferol
Identifiers
CAS Number	41294-56-8 ;
3D model (JSmol)	Interactive image;
ChEBI	CHEBI:31186 ;
ChEMBL	ChEMBL32540 ;
ChemSpider	4445376 ;
DrugBank	DB01436 ;
KEGG	D01518 ;
PubChem CID	5282181;
UNII	URQ2517572 ;
	InChI InChI=1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 Key: OFHCOWSQAMBJIW-AVJTYSNKSA-N ; InChI=1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 Key: OFHCOWSQAMBJIW-AVJTYSNKBM;
	SMILES O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C;
Properties
Chemical formula	C27H44O2
Molar mass	400.64 g/mol
Melting point	136 °C (277 °F; 409 K)
Solubility in water	0.016 g/100 mL
Pharmacology
ATC code	A11CC03 (WHO)
License data	EU EMA: by INN;
Legal status	UK: POM (Prescription only) ; EU: Rx-only ;

VisualWikitext

Latest revision as of 22:20, 12 April 2024

Information about message (contribute)

This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.

Message definition (Alfacalcidol)

{{chembox
| Verifiedfields = changed
| verifiedrevid = 477317096
| ImageFile=alfacalcidol.png
| ImageFile2=Alfacalcidol ball-and-stick.png
| PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol
| OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = URQ2517572
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31186
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 32540
| InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=41294-56-8
| PubChem=5282181
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445376
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01436
| SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
}}
|Section2={{Chembox Properties
| Formula=C27H44O2
| MolarMass=400.64 g/mol
| Appearance=
| Density=
| MeltingPtC= 136
| BoilingPt=
| Solubility= 0.016 g/100 mL
}}
| Section6 = {{Chembox Pharmacology
| Pharmacology_ref =
| ATCCode_prefix = A11
| ATCCode_suffix = CC03
| ATC_Supplemental =
| ATCvet =
| Licence_EU = yes
| INN =
| INN_EMA =
| Licence_US =
| Legal_status =
| Legal_AU =
| Legal_AU_comment =
| Legal_CA =
| Legal_CA_comment =
| Legal_NZ =
| Legal_NZ_comment =
| Legal_UK = POM
| Legal_UK_comment =
| Legal_US =
| Legal_US_comment =
| Legal_EU = Rx-only
| Legal_EU_comment =
| Legal_UN =
| Legal_UN_comment =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_AU_comment =
| Dependence_liability =
| AdminRoutes =
| Bioavail =
| ProteinBound =
| Metabolism =
| Metabolites =
| OnsetOfAction =
| HalfLife =
| DurationOfAction =
| Excretion =
}}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}

Translations:Alfacalcidol/1/ja: Difference between revisions

Latest revision as of 22:20, 12 April 2024

Navigation menu

Search