Translations:Cholecalciferol/6/en: Difference between revisions

Latest revision as of 21:28, 11 April 2024

Information about message (contribute)

This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.

Message definition (Cholecalciferol)

| IUPAC_name = (3''S'',5''Z'',7''E'')-9,10-secocholesta-5,7,10(19)-trien-3-ol
| C=27|H=44|O=1
| SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
| StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N
| density =
| density_notes =
| melting_point = 83 to 86
| melting_high =
| melting_notes =
| boiling_point = 496.4
| boiling_notes =
| solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils.
| sol_units =
| specific_rotation =
}}

| IUPAC_name = (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol | C=27|H=44|O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C | StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 | StdInChI_Ref = ^N | StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N | density = | density_notes = | melting_point = 83 to 86 | melting_high = | melting_notes = | boiling_point = 496.4 | boiling_notes = | solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils. | sol_units = | specific_rotation = }}

Translations:Cholecalciferol/6/en: Difference between revisions

Latest revision as of 21:28, 11 April 2024

Navigation menu

Search