Translations:Cholecalciferol/6/en: Difference between revisions
Importing a new version from external source |
(No difference)
|
Latest revision as of 21:28, 11 April 2024
| IUPAC_name = (3S,5Z,7E)-9,10-secocholesta-5,7,10(19)-trien-3-ol
| C=27|H=44|O=1
| SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
| StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1
| StdInChI_Ref =
| StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N
| density =
| density_notes =
| melting_point = 83 to 86
| melting_high =
| melting_notes =
| boiling_point = 496.4
| boiling_notes =
| solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils.
| sol_units =
| specific_rotation =
}}