Translations:Nicotinamide riboside/1/ja: Difference between revisions

From Azupedia
Jump to navigation Jump to search
VisualWikitext
Created page with "{{Chembox | Name = | ImageFile = nicotinamide-beta-riboside.svg | ImageAlt = | ImageCaption = | ImageFile1 = Nicotinamideriboside.png | ImageAlt1 = | ImageCaption1 = | IUPACName = 3-Carbamoyl-1-(β-<small>D</small>-ribofuranosyl)pyridin-1-ium | SystematicName = 3-Carbamoyl-1-[(2''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium | OtherNames = 1-(β-<small>D</small>-Ribofuranosyl)nicotinamide; ''N''-Ribosylnicotinamide |Section1={{Che..."
 
(No difference)

Latest revision as of 08:20, 8 April 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Nicotinamide riboside)
{{Chembox
| Name = 
| ImageFile = nicotinamide-beta-riboside.svg
| ImageAlt = 
| ImageCaption = 
| ImageFile1 = Nicotinamideriboside.png
| ImageAlt1 =
| ImageCaption1 = 
| IUPACName = 3-Carbamoyl-1-(β-<small>D</small>-ribofuranosyl)pyridin-1-ium
| SystematicName = 3-Carbamoyl-1-[(2''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium
| OtherNames = 1-(β-<small>D</small>-Ribofuranosyl)nicotinamide; ''N''-Ribosylnicotinamide
|Section1={{Chembox Identifiers
| Abbreviations = 
| CASNo = 1341-23-7
| CASNo_Comment = 
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0I8H2M0L7N
| CASNoOther = 
| PubChem = 439924 
| PubChem_Comment = 
| PubChem5 = 
| PubChem5_Comment = 
| PubChemOther = 
|  ChemSpiderID = 388956
| ChemSpiderID_Comment = 
| ChemSpiderID5 = 
| ChemSpiderIDOther = 
| EINECS = 
| EC_number = 
| UNNumber = 
| DrugBank = 
| MeSHName = 
| ChEBI = 15927 
| RTECS = 
|  SMILES = c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N
|  StdInChI = 1S/C11H14N2O5/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18
| Beilstein = 
| Gmelin = 
| 3DMet = }}
|Section2={{Chembox Properties
| Formula = C<sub>11</sub>H<sub>15</sub>N<sub>2</sub>O<sub>5</sub><sup>+</sup> 
| MolarMass = 255.25 g/mol
| Appearance = 
| Density = 
| MeltingPt = 
| MeltingPt_notes = 
| BoilingPt = 
| BoilingPt_notes = 
| LogP = 
| VaporPressure = 
| HenryConstant = 
| AtmosphericOHRateConstant = 
| pKa = 
| pKb = 
| Solubility = 
| SolubleOther = 
| Solvent = }}
|Section3={{Chembox Structure
| CrystalStruct = 
| Coordination = 
| MolShape = }}
|Section4={{Chembox Thermochemistry
| DeltaHc = 
| DeltaHf = 
| Entropy = 
| HeatCapacity = }}
|Section5={{Chembox Pharmacology
| AdminRoutes = 
| Bioavail = 
| Metabolism = 
| HalfLife = 
| ProteinBound = 
| Excretion = 
| Legal_status = 
| Legal_US = 
| Legal_UK = 
| Legal_AU = 
| Legal_CA = 
| Pregnancy_category = 
| Pregnancy_AU = 
| Pregnancy_US = }}
|Section6={{Chembox Explosive
| ShockSens = 
| FrictionSens = 
| DetonationV = 
| REFactor = }}
|Section7={{Chembox Hazards
| ExternalSDS = 
| MainHazards = 
| NFPA-H = 
| NFPA-F = 
| NFPA-R = 
| NFPA-S = 
| FlashPt = 
| AutoignitionPt = 
| ExploLimits = 
| LD50 = 
| PEL = }}
|Section8={{Chembox Related
| OtherAnions = 
| OtherCations = 
| OtherFunction = 
| OtherFunction_label = 
| OtherCompounds = }}
}}
Nicotinamide riboside/1/ja
Names
IUPAC name
3-Carbamoyl-1-(β-D-ribofuranosyl)pyridin-1-ium
Systematic IUPAC name
3-Carbamoyl-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium
Other names
1-(β-D-Ribofuranosyl)nicotinamide; N-Ribosylnicotinamide
Identifiers
3D model (JSmol)
ChEBI
ChemSpider
UNII
Properties
C11H15N2O5+
Molar mass 255.25 g/mol
Retrieved from "https://wiki.tiffa.net/w/index.php?title=Translations:Nicotinamide_riboside/1/ja&oldid=136390"