Translations:Riboflavin/6/ja: Difference between revisions
Jump to navigation
Jump to search
Created page with "<!-- Chemical and physical data --> | C=17 | H=20 | N=4 | O=6 | SMILES = c12cc(C)c(C)cc1N=C3C(=O)NC(=O)N=C3N2C[C@H](O)[C@H](O)[C@H](O)CO | StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N | StdInChIKey_Ref = {{stdin..." |
(No difference)
|
Latest revision as of 16:29, 19 February 2024
| C=17 | H=20 | N=4 | O=6
| SMILES = c12cc(C)c(C)cc1N=C3C(=O)NC(=O)N=C3N2C[C@H](O)[C@H](O)[C@H](O)CO
| StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
| StdInChI_Ref =
| StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N
| StdInChIKey_Ref =
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
}}