All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{chembox | Verifiedfields = changed | verifiedrevid = 470606219 | ImageFile=Thiamine monophosphate.svg | ImageSize=250px | IUPACName= | OtherNames= |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 10307 | InChI = 1/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H | InChIKey = GUGWNSHJDUEHNJ-UHFFFAOYAK | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GUGWNSHJDUEHNJ-UHFFFAOYSA-N | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 71F2V60NN0 | CASNo= 10023-48-0 | CASNo_Ref = {{cascite|correct|CAS}} | PubChem = 10761 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 9533 | SMILES = Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)O.[Cl-] | MeSHName=Thiamine+Monophosphate }} |Section2={{Chembox Properties | Formula=C<sub>12</sub>H<sub>18</sub>N<sub>4</sub>O<sub>4</sub>PS+ | MolarMass=345.336 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} |
| h Japanese (ja) | {{chembox | Verifiedfields = changed | verifiedrevid = 470606219 | ImageFile=Thiamine monophosphate.svg | ImageSize=250px | IUPACName= | OtherNames= |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 10307 | InChI = 1/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H | InChIKey = GUGWNSHJDUEHNJ-UHFFFAOYAK | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C12H17N4O4PS.ClH/c1-8-11(3-4-20-21(17,18)19)22-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7H,3-4,6H2,1-2H3,(H3-,13,14,15,17,18,19);1H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GUGWNSHJDUEHNJ-UHFFFAOYSA-N | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 71F2V60NN0 | CASNo= 10023-48-0 | CASNo_Ref = {{cascite|correct|CAS}} | PubChem = 10761 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 9533 | SMILES = Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)O.[Cl-] | MeSHName=Thiamine+Monophosphate }} |Section2={{Chembox Properties | Formula=C<sub>12</sub>H<sub>18</sub>N<sub>4</sub>O<sub>4</sub>PS+ | MolarMass=345.336 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} |