All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!-- Chemical and physical data --> | IUPAC_name = (''R'')-4-oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-''a'']pyrazin-7(8''H'')-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine | C=16 | H=15 | F=6 | N=5 | O=1 | SMILES = Fc1cc(c(F)cc1F)C[C@@H](N)CC(=O)N3Cc2nnc(n2CC3)C(F)(F)F | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2/t9-/m1/s1 | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MFFMDFFZMYYVKS-SECBINFHSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |
| h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = (''R'')-4-oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-''a'']pyrazin-7(8''H'')-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine | C=16 | H=15 | F=6 | N=5 | O=1 | SMILES = Fc1cc(c(F)cc1F)C[C@@H](N)CC(=O)N3Cc2nnc(n2CC3)C(F)(F)F | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2/t9-/m1/s1 | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MFFMDFFZMYYVKS-SECBINFHSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |