All translations

Jump to navigation Jump to search

Enter a message name below to show all available translations.

Message

Found 2 translations.

NameCurrent message text
 h English (en){{Short description|chemical compound}}
{{Pathnav|Dietary supplement|Vitamin|frame=1}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477003091
| ImageFile = (R)-Pantothenic acid Formula V.1.svg
| ImageSize =
| ImageName = Skeletal formula of (R)-pantothenic acid
| ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png
| ImageSize1 =
| ImageName1 = Pantothenic acid molecule
| PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid
| SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
|Section1={{Chembox Identifiers
| CASNo = 599-54-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 79-83-4
| CASNo1_Comment = (''R'')
| CASNo1_Ref = {{cascite|correct|CAS}}
| PubChem = 988
| PubChem1 = 6613
| PubChem1_Comment = (''R'')
| PubChem2 = 5748353
| PubChem2_Comment = (''S'')
| ChemSpiderID = 963
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 6361
| ChemSpiderID1_Comment = (''R'')
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID2 = 4677898
| ChemSpiderID2_Comment = (''S'')
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 66Y94D1203
| UNII1 = 19F5HK2737
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1_Comment = (''R'')
| EC_number = 209-965-4
| DrugBank = DB01783
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D07413
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Pantothenic+Acid
| ChEBI = 7916
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1594
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1727062, 1727064 (''R'')
| 3DMet = B00193
| SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O
| SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O
| SMILES1_Comment = (''R'')
| SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O
| SMILES2_Comment = (''S'')
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| RTECS = RU4729000
  }}
|Section2={{Chembox Properties
| C=9 | H=17 | N=1 | O=5
| Density = 1.266 g/cm<sup>3</sup><br/> 1.32 g/cm<sup>3</sup> (Ca<sup>2+</sup> salt)
| Appearance = Yellow oil<br/> Colorless crystals (Ca<sup>2+</sup> salt)
| Odor = Odorless
| MeltingPtC = 183.833
| MeltingPt_notes = <br/> {{convert|196-200|C|F K}}<br/> decomposes (Ca<sup>2+</sup> salt)
| LogP = −1.416
| pKa = 4.41
| pKb = 9.698
| Solubility = Very soluble
| SolubleOther = Very soluble in [[benzene|C<sub>6</sub>H<sub>6</sub>]], [[diethyl ether|ether]]
| SpecRotation = +37.5°<br/> +24.3° (Ca<sup>2+</sup> salt)
  }}
|Section7={{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| LD50 = > 10 mg/g (Ca<sup>2+</sup> salt)
  }}
|Section9={{Chembox Related
| OtherFunction_label = alkanoic acids
| OtherFunction = [[Arginine]]<br/>[[Hopantenic acid]]<br/>[[4-(γ-Glutamylamino)butanoic acid]]
| OtherCompounds = [[Panthenol]]
  }}
}}
 h Japanese (ja){{Pathnav|Dietary supplement/ja|Vitamin/ja|frame=1}}
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477003091
| ImageFile = (R)-Pantothenic acid Formula V.1.svg
| ImageSize =
| ImageName = (R)-パントテン酸の骨格式
| ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png
| ImageSize1 =
| ImageName1 = パントテン酸分子
| PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid
| SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid
|Section1={{Chembox Identifiers
| CASNo = 599-54-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 79-83-4
| CASNo1_Comment = (''R'')
| CASNo1_Ref = {{cascite|correct|CAS}}
| PubChem = 988
| PubChem1 = 6613
| PubChem1_Comment = (''R'')
| PubChem2 = 5748353
| PubChem2_Comment = (''S'')
| ChemSpiderID = 963
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID1 = 6361
| ChemSpiderID1_Comment = (''R'')
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID2 = 4677898
| ChemSpiderID2_Comment = (''S'')
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 66Y94D1203
| UNII1 = 19F5HK2737
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1_Comment = (''R'')
| EC_number = 209-965-4
| DrugBank = DB01783
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| KEGG = D07413
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = Pantothenic+Acid
| ChEBI = 7916
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1594
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| Beilstein = 1727062, 1727064 (''R'')
| 3DMet = B00193
| SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O
| SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O
| SMILES1_Comment = (''R'')
| SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O
| SMILES2_Comment = (''S'')
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| RTECS = RU4729000
  }}
|Section2={{Chembox Properties
| C=9 | H=17 | N=1 | O=5
| Density = 1.266 g/cm<sup>3</sup><br/> 1.32 g/cm<sup>3</sup> (Ca<sup>2+</sup> salt)
| Appearance = Yellow oil<br/> Colorless crystals (Ca<sup>2+</sup> salt)
| Odor = Odorless
| MeltingPtC = 183.833
| MeltingPt_notes = <br/> {{convert|196-200|C|F K}}<br/> decomposes (Ca<sup>2+</sup> salt)
| LogP = −1.416
| pKa = 4.41
| pKb = 9.698
| Solubility = Very soluble
| SolubleOther = Very soluble in [[benzene/ja|C<sub>6</sub>H<sub>6</sub>]], [[diethyl ether/ja|ether]]
| SpecRotation = +37.5°<br/> +24.3° (Ca<sup>2+</sup> salt)
  }}
|Section7={{Chembox Hazards
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 0
| LD50 = > 10 mg/g (Ca<sup>2+</sup> salt)
  }}
|Section9={{Chembox Related
| OtherFunction_label = alkanoic acids
| OtherFunction = [[Arginine/ja]]<br/>[[Hopantenic acid/ja]]<br/>[[4-(γ-Glutamylamino)butanoic acid/ja]]
| OtherCompounds = [[Panthenol/ja]]
  }}
}}
Retrieved from "https://wiki.tiffa.net/wiki/Special:Translations"