All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{Short description|chemical compound}} {{Pathnav|Dietary supplement|Vitamin|frame=1}} {{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477003091 | ImageFile = (R)-Pantothenic acid Formula V.1.svg | ImageSize = | ImageName = Skeletal formula of (R)-pantothenic acid | ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png | ImageSize1 = | ImageName1 = Pantothenic acid molecule | PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid | SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid |Section1={{Chembox Identifiers | CASNo = 599-54-2 | CASNo_Ref = {{cascite|correct|CAS}} | CASNo1 = 79-83-4 | CASNo1_Comment = (''R'') | CASNo1_Ref = {{cascite|correct|CAS}} | PubChem = 988 | PubChem1 = 6613 | PubChem1_Comment = (''R'') | PubChem2 = 5748353 | PubChem2_Comment = (''S'') | ChemSpiderID = 963 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID1 = 6361 | ChemSpiderID1_Comment = (''R'') | ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID2 = 4677898 | ChemSpiderID2_Comment = (''S'') | ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 66Y94D1203 | UNII1 = 19F5HK2737 | UNII1_Ref = {{fdacite|correct|FDA}} | UNII1_Comment = (''R'') | EC_number = 209-965-4 | DrugBank = DB01783 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | KEGG = D07413 | KEGG_Ref = {{keggcite|correct|kegg}} | MeSHName = Pantothenic+Acid | ChEBI = 7916 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1594 | ChEMBL_Ref = {{ebicite|correct|EBI}} | Beilstein = 1727062, 1727064 (''R'') | 3DMet = B00193 | SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O | SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O | SMILES1_Comment = (''R'') | SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O | SMILES2_Comment = (''S'') | StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | RTECS = RU4729000 }} |Section2={{Chembox Properties | C=9 | H=17 | N=1 | O=5 | Density = 1.266 g/cm<sup>3</sup><br/> 1.32 g/cm<sup>3</sup> (Ca<sup>2+</sup> salt) | Appearance = Yellow oil<br/> Colorless crystals (Ca<sup>2+</sup> salt) | Odor = Odorless | MeltingPtC = 183.833 | MeltingPt_notes = <br/> {{convert|196-200|C|F K}}<br/> decomposes (Ca<sup>2+</sup> salt) | LogP = −1.416 | pKa = 4.41 | pKb = 9.698 | Solubility = Very soluble | SolubleOther = Very soluble in [[benzene|C<sub>6</sub>H<sub>6</sub>]], [[diethyl ether|ether]] | SpecRotation = +37.5°<br/> +24.3° (Ca<sup>2+</sup> salt) }} |Section7={{Chembox Hazards | NFPA-H = 2 | NFPA-F = 1 | NFPA-R = 0 | LD50 = > 10 mg/g (Ca<sup>2+</sup> salt) }} |Section9={{Chembox Related | OtherFunction_label = alkanoic acids | OtherFunction = [[Arginine]]<br/>[[Hopantenic acid]]<br/>[[4-(γ-Glutamylamino)butanoic acid]] | OtherCompounds = [[Panthenol]] }} }} |
| h Japanese (ja) | {{Pathnav|Dietary supplement/ja|Vitamin/ja|frame=1}} {{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477003091 | ImageFile = (R)-Pantothenic acid Formula V.1.svg | ImageSize = | ImageName = (R)-パントテン酸の骨格式 | ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png | ImageSize1 = | ImageName1 = パントテン酸分子 | PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid | SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid |Section1={{Chembox Identifiers | CASNo = 599-54-2 | CASNo_Ref = {{cascite|correct|CAS}} | CASNo1 = 79-83-4 | CASNo1_Comment = (''R'') | CASNo1_Ref = {{cascite|correct|CAS}} | PubChem = 988 | PubChem1 = 6613 | PubChem1_Comment = (''R'') | PubChem2 = 5748353 | PubChem2_Comment = (''S'') | ChemSpiderID = 963 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID1 = 6361 | ChemSpiderID1_Comment = (''R'') | ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID2 = 4677898 | ChemSpiderID2_Comment = (''S'') | ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 66Y94D1203 | UNII1 = 19F5HK2737 | UNII1_Ref = {{fdacite|correct|FDA}} | UNII1_Comment = (''R'') | EC_number = 209-965-4 | DrugBank = DB01783 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | KEGG = D07413 | KEGG_Ref = {{keggcite|correct|kegg}} | MeSHName = Pantothenic+Acid | ChEBI = 7916 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1594 | ChEMBL_Ref = {{ebicite|correct|EBI}} | Beilstein = 1727062, 1727064 (''R'') | 3DMet = B00193 | SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O | SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O | SMILES1_Comment = (''R'') | SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O | SMILES2_Comment = (''S'') | StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13) | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | RTECS = RU4729000 }} |Section2={{Chembox Properties | C=9 | H=17 | N=1 | O=5 | Density = 1.266 g/cm<sup>3</sup><br/> 1.32 g/cm<sup>3</sup> (Ca<sup>2+</sup> salt) | Appearance = Yellow oil<br/> Colorless crystals (Ca<sup>2+</sup> salt) | Odor = Odorless | MeltingPtC = 183.833 | MeltingPt_notes = <br/> {{convert|196-200|C|F K}}<br/> decomposes (Ca<sup>2+</sup> salt) | LogP = −1.416 | pKa = 4.41 | pKb = 9.698 | Solubility = Very soluble | SolubleOther = Very soluble in [[benzene/ja|C<sub>6</sub>H<sub>6</sub>]], [[diethyl ether/ja|ether]] | SpecRotation = +37.5°<br/> +24.3° (Ca<sup>2+</sup> salt) }} |Section7={{Chembox Hazards | NFPA-H = 2 | NFPA-F = 1 | NFPA-R = 0 | LD50 = > 10 mg/g (Ca<sup>2+</sup> salt) }} |Section9={{Chembox Related | OtherFunction_label = alkanoic acids | OtherFunction = [[Arginine/ja]]<br/>[[Hopantenic acid/ja]]<br/>[[4-(γ-Glutamylamino)butanoic acid/ja]] | OtherCompounds = [[Panthenol/ja]] }} }} |