All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{chembox | Verifiedfields = changed | verifiedrevid = 402518121 | ImageFile = pantethine structure.png | ImageSize = 300px | SystematicName = (2''R'',2′''R'')-''N'',''N''′-(3,12-Dioxo-7,8-dithia-4,11-diazatetradecane-1,14-diyl)bis(2,4-dihydroxy-3,3-dimethylbutanamide) | OtherNames = Bis-pantethine<br>Co-enzyme pantethine |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4515 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2104786 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7K81IL792L | InChI = 1/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34) | InChIKey = DJWYOLJPSHDSAL-UHFFFAOYAZ | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DJWYOLJPSHDSAL-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 16816-67-4 | PubChem = 4677 | SMILES = O=C(NCCSSCCNC(=O)CCNC(=O)C(O)C(C)(C)CO)CCNC(=O)C(O)C(C)(C)CO }} |Section2={{Chembox Properties | C=22 | H=42 | N=4 | O=8 | S=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section6={{Chembox Pharmacology | ATCCode_prefix = A11 | ATCCode_suffix = HA32 }} |Section7={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | NFPA-H = 2 | NFPA-F = 1 | NFPA-R = 0 }} }} |
| h Japanese (ja) | {{chembox | Verifiedfields = changed | verifiedrevid = 402518121 | ImageFile = pantethine structure.png | ImageSize = 300px | SystematicName = (2''R'',2′''R'')-''N'',''N''′-(3,12-Dioxo-7,8-dithia-4,11-diazatetradecane-1,14-diyl)bis(2,4-dihydroxy-3,3-dimethylbutanamide) | OtherNames = Bis-pantethine<br>Co-enzyme pantethine |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4515 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2104786 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7K81IL792L | InChI = 1/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34) | InChIKey = DJWYOLJPSHDSAL-UHFFFAOYAZ | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H42N4O8S2/c1-21(2,13-27)17(31)19(33)25-7-5-15(29)23-9-11-35-36-12-10-24-16(30)6-8-26-20(34)18(32)22(3,4)14-28/h17-18,27-28,31-32H,5-14H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)(H,26,34) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DJWYOLJPSHDSAL-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 16816-67-4 | PubChem = 4677 | SMILES = O=C(NCCSSCCNC(=O)CCNC(=O)C(O)C(C)(C)CO)CCNC(=O)C(O)C(C)(C)CO }} |Section2={{Chembox Properties | C=22 | H=42 | N=4 | O=8 | S=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section6={{Chembox Pharmacology | ATCCode_prefix = A11 | ATCCode_suffix = HA32 }} |Section7={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | NFPA-H = 2 | NFPA-F = 1 | NFPA-R = 0 }} }} |