All translations

Jump to navigation Jump to search

Enter a message name below to show all available translations.

Message

Found 2 translations.

NameCurrent message text
 h English (en){{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name        = methyl 6-(acetylsulfanyl)-8-<nowiki/>{[(2E)-2-<nowiki/>{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate
| image            = Octotiamine.svg
| width            = 250
| image2            = Octotiamine 3D.png
| width2            = 160
| CAS_number        = 137-86-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UN1Q7096GA
| ATC_prefix        = None
| ATC_suffix        = 
| PubChem          = 3034020
| DrugBank          = 
| ChemSpiderID      = 2298574
| chemical_formula =
| C=23 | H=36 | N=4 | O=5 | S=3 
| SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C
| StdInChI          = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+
| StdInChIKey      = VJTXQHYNRDGLON-LTGZKZEYSA-N
| bioavailability  = 
| protein_bound    = 
| metabolism        = 
| elimination_half-life = 
| excretion        = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}
 h Japanese (ja){{Drugbox
| IUPAC_name        = methyl 6-(acetylsulfanyl)-8-<nowiki/>{[(2E)-2-<nowiki/>{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate
| image            = Octotiamine.svg
| width            = 250
| image2            = Octotiamine 3D.png
| width2            = 160
| CAS_number        = 137-86-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UN1Q7096GA
| ATC_prefix        = None
| ATC_suffix        = 
| PubChem          = 3034020
| DrugBank          = 
| ChemSpiderID      = 2298574
| chemical_formula =
| C=23 | H=36 | N=4 | O=5 | S=3 
| SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C
| StdInChI          = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+
| StdInChIKey      = VJTXQHYNRDGLON-LTGZKZEYSA-N
| bioavailability  = 
| protein_bound    = 
| metabolism        = 
| elimination_half-life = 
| excretion        = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}