All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{Chembox | Name = | ImageFile = nicotinamide-beta-riboside.svg | ImageAlt = | ImageCaption = | ImageFile1 = Nicotinamideriboside.png | ImageAlt1 = | ImageCaption1 = | IUPACName = 3-Carbamoyl-1-(β-<small>D</small>-ribofuranosyl)pyridin-1-ium | SystematicName = 3-Carbamoyl-1-[(2''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium | OtherNames = 1-(β-<small>D</small>-Ribofuranosyl)nicotinamide; ''N''-Ribosylnicotinamide |Section1={{Chembox Identifiers | Abbreviations = | CASNo = 1341-23-7 | CASNo_Comment = | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 0I8H2M0L7N | CASNoOther = | PubChem = 439924 | PubChem_Comment = | PubChem5 = | PubChem5_Comment = | PubChemOther = | ChemSpiderID = 388956 | ChemSpiderID_Comment = | ChemSpiderID5 = | ChemSpiderIDOther = | EINECS = | EC_number = | UNNumber = | DrugBank = | MeSHName = | ChEBI = 15927 | RTECS = | SMILES = c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | StdInChI = 1S/C11H14N2O5/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18 | Beilstein = | Gmelin = | 3DMet = }} |Section2={{Chembox Properties | Formula = C<sub>11</sub>H<sub>15</sub>N<sub>2</sub>O<sub>5</sub><sup>+</sup> | MolarMass = 255.25 g/mol | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = | Solubility = | SolubleOther = | Solvent = }} |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = }} |Section4={{Chembox Thermochemistry | DeltaHc = | DeltaHf = | Entropy = | HeatCapacity = }} |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = }} |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = }} }} |
| h Japanese (ja) | {{Chembox | Name = | ImageFile = nicotinamide-beta-riboside.svg | ImageAlt = | ImageCaption = | ImageFile1 = Nicotinamideriboside.png | ImageAlt1 = | ImageCaption1 = | IUPACName = 3-Carbamoyl-1-(β-<small>D</small>-ribofuranosyl)pyridin-1-ium | SystematicName = 3-Carbamoyl-1-[(2''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium | OtherNames = 1-(β-<small>D</small>-Ribofuranosyl)nicotinamide; ''N''-Ribosylnicotinamide |Section1={{Chembox Identifiers | Abbreviations = | CASNo = 1341-23-7 | CASNo_Comment = | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 0I8H2M0L7N | CASNoOther = | PubChem = 439924 | PubChem_Comment = | PubChem5 = | PubChem5_Comment = | PubChemOther = | ChemSpiderID = 388956 | ChemSpiderID_Comment = | ChemSpiderID5 = | ChemSpiderIDOther = | EINECS = | EC_number = | UNNumber = | DrugBank = | MeSHName = | ChEBI = 15927 | RTECS = | SMILES = c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | StdInChI = 1S/C11H14N2O5/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18 | Beilstein = | Gmelin = | 3DMet = }} |Section2={{Chembox Properties | Formula = C<sub>11</sub>H<sub>15</sub>N<sub>2</sub>O<sub>5</sub><sup>+</sup> | MolarMass = 255.25 g/mol | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = | Solubility = | SolubleOther = | Solvent = }} |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = }} |Section4={{Chembox Thermochemistry | DeltaHc = | DeltaHf = | Entropy = | HeatCapacity = }} |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = }} |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = }} }} |