All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{Chembox <!-- Images --> | ImageFile = Nicotinamide mononucleotide.svg | ImageSize = 220px <!-- Names --> | IUPACName = 3-Carbamoyl-1-(5-''O''-phosphono-β-<small>D</small>-ribofuranosyl)pyridin-1-ium | SystematicName = [(2''R'',3''S'',4''R'',5''R'')-5-(3-Carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | OtherNames = {{unbulleted list | Nicotinamide ribonucleoside 5′-phosphate | Nicotinamide <small>D</small>-ribonucleotide | β-Nicotinamide ribose monophosphate| Nicotinamide nucleotide }} <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 1094-61-7 | CASNo_Ref = {{cascite|correct|CAS}} | Beilstein = 3570187 | ChEBI = 16171 | ChEMBL = 610238 | EINECS = 214-136-5 | KEGG = C00455 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2KG6QX4W0V | PubChem = 16219737 | ChemSpiderID = 13553 | SMILES = c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)[O-])O)O)C(=O)N | StdInChI = 1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/t7-,8-,9-,11-/m1/s1 | StdInChIKey = DAYLJWODMCOQEW-TURQNECASA-N }} | Section2 = {{Chembox Properties | C=11|H=15|N=2|O=8|P=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} |
| h Japanese (ja) | {{Chembox <!-- Images --> | ImageFile = Nicotinamide mononucleotide.svg | ImageSize = 220px <!-- Names --> | IUPACName = 3-Carbamoyl-1-(5-''O''-phosphono-β-<small>D</small>-ribofuranosyl)pyridin-1-ium | SystematicName = [(2''R'',3''S'',4''R'',5''R'')-5-(3-Carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | OtherNames = {{unbulleted list | Nicotinamide ribonucleoside 5′-phosphate | Nicotinamide <small>D</small>-ribonucleotide | β-Nicotinamide ribose monophosphate| Nicotinamide nucleotide }} <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 1094-61-7 | CASNo_Ref = {{cascite|correct|CAS}} | Beilstein = 3570187 | ChEBI = 16171 | ChEMBL = 610238 | EINECS = 214-136-5 | KEGG = C00455 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2KG6QX4W0V | PubChem = 16219737 | ChemSpiderID = 13553 | SMILES = c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)[O-])O)O)C(=O)N | StdInChI = 1S/C11H15N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-4,7-9,11,14-15H,5H2,(H3-,12,16,17,18,19)/t7-,8-,9-,11-/m1/s1 | StdInChIKey = DAYLJWODMCOQEW-TURQNECASA-N }} | Section2 = {{Chembox Properties | C=11|H=15|N=2|O=8|P=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} |