All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
Name | Current message text |
---|---|
h English (en) | <!-- Chemical and physical data --> | IUPAC_name = (2-butyl-4-chloro-1-{[2'-(2''H''-tetrazol-5-yl)biphenyl-4-yl]methyl}-1''H''-imidazol-5-yl)methanol | C=22 | H=23 | Cl=1 | N=6 | O=1 | SMILES = CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = PSIFNNKUMBGKDQ-UHFFFAOYSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |
h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = (2-butyl-4-chloro-1-{[2'-(2''H''-tetrazol-5-yl)biphenyl-4-yl]methyl}-1''H''-imidazol-5-yl)methanol | C=22 | H=23 | Cl=1 | N=6 | O=1 | SMILES = CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = PSIFNNKUMBGKDQ-UHFFFAOYSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |