All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!-- Chemical data --> | IUPAC_name = 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-<br />1,3-thiazole-5-carboxylic acid | C=16 | H=16 | N=2 | Na= | O=3 | S=1 | smiles = N#Cc1c(OCC(C)C)ccc(c1)c2nc(c(s2)C(=O)O)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BQSJTQLCZDPROO-UHFFFAOYSA-N }} |
| h Japanese (ja) | <!-- Chemical data --> | IUPAC_name = 2-(3-cyano-4-isobutoxyphenyl)-4-methyl-<br />1,3-thiazole-5-carboxylic acid | C=16 | H=16 | N=2 | Na= | O=3 | S=1 | smiles = N#Cc1c(OCC(C)C)ccc(c1)c2nc(c(s2)C(=O)O)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BQSJTQLCZDPROO-UHFFFAOYSA-N }} |