All translations
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!-- Chemical and physical data --> | IUPAC_name = (3''S'',5''Z'',7''E'')-9,10-secocholesta-5,7,10(19)-trien-3-ol | C=27|H=44|O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C | StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N | density = | density_notes = | melting_point = 83 to 86 | melting_high = | melting_notes = | boiling_point = 496.4 | boiling_notes = | solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils. | sol_units = | specific_rotation = }} |
| h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = (3''S'',5''Z'',7''E'')-9,10-secocholesta-5,7,10(19)-trien-3-ol | C=27|H=44|O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C | StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = QYSXJUFSXHHAJI-YRZJJWOYSA-N | density = | density_notes = | melting_point = 83 to 86 | melting_high = | melting_notes = | boiling_point = 496.4 | boiling_notes = | solubility = Practically insoluble in water, freely soluble in ethanol, methanol and some other organic solvents. Slightly soluble in vegetable oils. | sol_units = | specific_rotation = }} |