All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 476998694 | ImageFile =calcium lactate.png | ImageSize = | PIN =Calcium bis(2-hydroxypropanoate) | OtherNames = {{Unbulleted list | calcium lactate 5-hydrate | calcium lactate | 2-hydroxypropanoic acid | calcium salt pentahydrate }} |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 12592 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2URQ2N32W3 | InChI = 1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 | InChIKey = MKJXYGKVIBWPFZ-NUQVWONBAM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MKJXYGKVIBWPFZ-UHFFFAOYSA-L | CASNo_Ref = {{cascite|correct|CAS}} | CASNo =814-80-2 | PubChem =13144 | EC_number = 212-406-7 | DrugBank = DB13231 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 2106111 | SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C }} |Section2={{Chembox Properties | Formula =C<sub>6</sub>H<sub>10</sub>CaO<sub>6</sub> | MolarMass =218.22 g/mol | Appearance = white or off-white powder, slightly [[efflorescent]] | Density = 1.494 g/cm<sup>3</sup> | MeltingPtC = 240 | MeltingPt_notes = (anhydrous) <br> 120 °C (pentahydrate) | BoilingPt = | Solubility = L-lactate, anhydrous, g/100 mL: 4.8 (10 °C), 5.8 (20 °C), 6.7 (25 °C), 8.5 (30 °C); 7.9 g/100 mL (30 °C) | SolubleOther = very soluble in [[methanol]], insoluble in [[ethanol]] | pKa = 6.0-8.5 | RefractIndex = 1.470 }} |Section6={{Chembox Pharmacology | ATCCode_prefix = A12 | ATCCode_suffix = AA05 }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|319}} | PPhrases = {{P-phrases|264|280|305+351+338|337+313}} | MainHazards = | FlashPt = Not applicable | AutoignitionPt = No data | NFPA-H = 1 | NFPA-F = 0 | NFPA-R = 0 }} }} |
| h Japanese (ja) | {{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 476998694 | ImageFile =calcium lactate.png | ImageSize = | PIN =Calcium bis(2-hydroxypropanoate) | OtherNames = {{Unbulleted list | calcium lactate 5-hydrate | calcium lactate | 2-hydroxypropanoic acid | calcium salt pentahydrate }} |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 12592 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2URQ2N32W3 | InChI = 1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 | InChIKey = MKJXYGKVIBWPFZ-NUQVWONBAM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MKJXYGKVIBWPFZ-UHFFFAOYSA-L | CASNo_Ref = {{cascite|correct|CAS}} | CASNo =814-80-2 | PubChem =13144 | EC_number = 212-406-7 | DrugBank = DB13231 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 2106111 | SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C }} |Section2={{Chembox Properties | Formula =C<sub>6</sub>H<sub>10</sub>CaO<sub>6</sub> | MolarMass =218.22 g/mol | Appearance = white or off-white powder, slightly [[efflorescent]] | Density = 1.494 g/cm<sup>3</sup> | MeltingPtC = 240 | MeltingPt_notes = (anhydrous) <br> 120 °C (pentahydrate) | BoilingPt = | Solubility = L-lactate, anhydrous, g/100 mL: 4.8 (10 °C), 5.8 (20 °C), 6.7 (25 °C), 8.5 (30 °C); 7.9 g/100 mL (30 °C) | SolubleOther = very soluble in [[methanol]], insoluble in [[ethanol]] | pKa = 6.0-8.5 | RefractIndex = 1.470 }} |Section6={{Chembox Pharmacology | ATCCode_prefix = A12 | ATCCode_suffix = AA05 }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|319}} | PPhrases = {{P-phrases|264|280|305+351+338|337+313}} | MainHazards = | FlashPt = Not applicable | AutoignitionPt = No data | NFPA-H = 1 | NFPA-F = 0 | NFPA-R = 0 }} }} |