All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
Name | Current message text |
---|---|
h English (en) | {{Short description|Thiamine analogue}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449055379 | IUPAC_name = ''S''-[2-{[(4-Amino-2-methylpyrimidin-5-yl)methyl] (formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate | image = Benfotiamine.svg | image2 = Benfotiamine ball-and-stick.png <!--Clinical data--> | tradename = Milgamma | Drugs.com = {{drugs.com|international|benfotiamine}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = OTC | routes_of_administration = Oral <!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 22457-89-2 | ATC_prefix = A11 | ATC_suffix = DA03 | PubChem = 3032771 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1491875 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 41039 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2297665 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Y92OUS2H9B | synonyms = <small>''S''-Benzoylthiamine O-monophosphate</small> <!--Chemical data--> | C=19 | H=23 | N=4 | O=6 | P=1 | S=1 | smiles = O=P(O)(O)OCCC(/SC(=O)c1ccccc1)=C(/N(C=O)Cc2cnc(nc2N)C)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BTNNPSLJPBRMLZ-LGMDPLHJSA-N }} |
h Japanese (ja) | {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449055379 | IUPAC_name = ''S''-[2-{[(4-Amino-2-methylpyrimidin-5-yl)methyl] (formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate | image = Benfotiamine.svg | image2 = Benfotiamine ball-and-stick.png <!--Clinical data--> | tradename = Milgamma | Drugs.com = {{drugs.com|international|benfotiamine}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = OTC | routes_of_administration = Oral <!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = <!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 22457-89-2 | ATC_prefix = A11 | ATC_suffix = DA03 | PubChem = 3032771 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1491875 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 41039 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2297665 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Y92OUS2H9B | synonyms = <small>''S''-Benzoylthiamine O-monophosphate</small> <!--Chemical data--> | C=19 | H=23 | N=4 | O=6 | P=1 | S=1 | smiles = O=P(O)(O)OCCC(/SC(=O)c1ccccc1)=C(/N(C=O)Cc2cnc(nc2N)C)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BTNNPSLJPBRMLZ-LGMDPLHJSA-N }} |