All translations

Jump to navigation Jump to search

Enter a message name below to show all available translations.

Message

Found 2 translations.

NameCurrent message text
 h English (en){{Short description|Thiamine analogue}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449055379
| IUPAC_name = ''S''-[2-{[(4-Amino-2-methylpyrimidin-5-yl)methyl] (formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate
| image = Benfotiamine.svg
| image2 = Benfotiamine ball-and-stick.png
<!--Clinical data-->
| tradename = Milgamma
| Drugs.com = {{drugs.com|international|benfotiamine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--            / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status = OTC
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 22457-89-2
| ATC_prefix = A11
| ATC_suffix = DA03
| PubChem = 3032771
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1491875
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 41039
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2297665
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y92OUS2H9B
| synonyms = <small>''S''-Benzoylthiamine&nbsp;O-monophosphate</small>
<!--Chemical data-->
| C=19 | H=23
| N=4 | O=6
| P=1 | S=1
| smiles = O=P(O)(O)OCCC(/SC(=O)c1ccccc1)=C(/N(C=O)Cc2cnc(nc2N)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BTNNPSLJPBRMLZ-LGMDPLHJSA-N
}}
 h Japanese (ja){{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 449055379
| IUPAC_name = ''S''-[2-{[(4-Amino-2-methylpyrimidin-5-yl)methyl] (formyl)amino}-5-(phosphonooxy)pent-2-en-3-yl] benzenecarbothioate
| image = Benfotiamine.svg
| image2 = Benfotiamine ball-and-stick.png
<!--Clinical data-->
| tradename = Milgamma
| Drugs.com = {{drugs.com|international|benfotiamine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--            / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status = OTC
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 22457-89-2
| ATC_prefix = A11
| ATC_suffix = DA03
| PubChem = 3032771
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1491875
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 41039
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2297665
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Y92OUS2H9B
| synonyms = <small>''S''-Benzoylthiamine&nbsp;O-monophosphate</small>
<!--Chemical data-->
| C=19 | H=23
| N=4 | O=6
| P=1 | S=1
| smiles = O=P(O)(O)OCCC(/SC(=O)c1ccccc1)=C(/N(C=O)Cc2cnc(nc2N)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BTNNPSLJPBRMLZ-LGMDPLHJSA-N
}}