All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!--Chemical data--> | C=15 | H=22 | N=4 | O=2 | S=2 | smiles = O=CN(/C(=C(\SSC\C=C)CCO)C)Cc1cnc(nc1N)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WNCAVNGLACHSRZ-KAMYIIQDSA-N }} |
| h Japanese (ja) | <!--Chemical data--> | C=15 | H=22 | N=4 | O=2 | S=2 | smiles = O=CN(/C(=C(\SSC\C=C)CCO)C)Cc1cnc(nc1N)C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WNCAVNGLACHSRZ-KAMYIIQDSA-N }} |