All translations
Jump to navigation
Jump to search
Enter a message name below to show all available translations.
Found 2 translations.
Name | Current message text |
---|---|
h English (en) | {{chembox | Verifiedfields = changed | verifiedrevid = 477317096 | ImageFile=alfacalcidol.png | ImageFile2=Alfacalcidol ball-and-stick.png | PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol | OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol |Section1={{Chembox Identifiers | UNII_Ref = {{fdacite|correct|FDA}} | UNII = URQ2517572 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 31186 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 32540 | InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 | InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=41294-56-8 | PubChem=5282181 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4445376 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D01518 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01436 | SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C }} |Section2={{Chembox Properties | Formula=C<sub>27</sub>H<sub>44</sub>O<sub>2</sub> | MolarMass=400.64 g/mol | Appearance= | Density= | MeltingPtC= 136 | BoilingPt= | Solubility= 0.016 g/100 mL }} | Section6 = {{Chembox Pharmacology | Pharmacology_ref = | ATCCode_prefix = A11 | ATCCode_suffix = CC03 | ATC_Supplemental = | ATCvet = | Licence_EU = yes | INN = | INN_EMA = | Licence_US = | Legal_status = | Legal_AU = | Legal_AU_comment = | Legal_CA = | Legal_CA_comment = | Legal_NZ = | Legal_NZ_comment = | Legal_UK = POM | Legal_UK_comment = | Legal_US = | Legal_US_comment = | Legal_EU = Rx-only | Legal_EU_comment = | Legal_UN = | Legal_UN_comment = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_AU_comment = | Dependence_liability = | AdminRoutes = | Bioavail = | ProteinBound = | Metabolism = | Metabolites = | OnsetOfAction = | HalfLife = | DurationOfAction = | Excretion = }} |Section7={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} |
h Japanese (ja) | {{chembox | Verifiedfields = changed | verifiedrevid = 477317096 | ImageFile=alfacalcidol.png | ImageFile2=Alfacalcidol ball-and-stick.png | PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol | OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol |Section1={{Chembox Identifiers | UNII_Ref = {{fdacite|correct|FDA}} | UNII = URQ2517572 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 31186 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 32540 | InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 | InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=41294-56-8 | PubChem=5282181 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4445376 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D01518 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01436 | SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C }} |Section2={{Chembox Properties | Formula=C<sub>27</sub>H<sub>44</sub>O<sub>2</sub> | MolarMass=400.64 g/mol | Appearance= | Density= | MeltingPtC= 136 | BoilingPt= | Solubility= 0.016 g/100 mL }} | Section6 = {{Chembox Pharmacology | Pharmacology_ref = | ATCCode_prefix = A11 | ATCCode_suffix = CC03 | ATC_Supplemental = | ATCvet = | Licence_EU = yes | INN = | INN_EMA = | Licence_US = | Legal_status = | Legal_AU = | Legal_AU_comment = | Legal_CA = | Legal_CA_comment = | Legal_NZ = | Legal_NZ_comment = | Legal_UK = POM | Legal_UK_comment = | Legal_US = | Legal_US_comment = | Legal_EU = Rx-only | Legal_EU_comment = | Legal_UN = | Legal_UN_comment = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_AU_comment = | Dependence_liability = | AdminRoutes = | Bioavail = | ProteinBound = | Metabolism = | Metabolites = | OnsetOfAction = | HalfLife = | DurationOfAction = | Excretion = }} |Section7={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} |