All translations

Jump to navigation Jump to search

Enter a message name below to show all available translations.

Message

Found 2 translations.

NameCurrent message text
 h English (en){{chembox
| Verifiedfields = changed
| verifiedrevid = 477317096
| ImageFile=alfacalcidol.png
| ImageFile2=Alfacalcidol ball-and-stick.png
| PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol
| OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = URQ2517572
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31186
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 32540
| InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=41294-56-8
| PubChem=5282181
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445376
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01436
| SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
}}
|Section2={{Chembox Properties
| Formula=C<sub>27</sub>H<sub>44</sub>O<sub>2</sub>
| MolarMass=400.64 g/mol
| Appearance=
| Density=
| MeltingPtC= 136
| BoilingPt=
| Solubility= 0.016 g/100 mL
  }}
| Section6 = {{Chembox Pharmacology
| Pharmacology_ref = 
| ATCCode_prefix = A11
| ATCCode_suffix = CC03
| ATC_Supplemental = 
| ATCvet = 
| Licence_EU = yes
| INN = 
| INN_EMA = 
| Licence_US = 
| Legal_status = 
| Legal_AU = 
| Legal_AU_comment = 
| Legal_CA = 
| Legal_CA_comment = 
| Legal_NZ = 
| Legal_NZ_comment = 
| Legal_UK = POM
| Legal_UK_comment = 
| Legal_US = 
| Legal_US_comment = 
| Legal_EU = Rx-only
| Legal_EU_comment = 
| Legal_UN = 
| Legal_UN_comment = 
| Pregnancy_category = 
| Pregnancy_AU = 
| Pregnancy_AU_comment = 
| Dependence_liability = 
| AdminRoutes = 
| Bioavail = 
| ProteinBound = 
| Metabolism = 
| Metabolites = 
| OnsetOfAction = 
| HalfLife = 
| DurationOfAction = 
| Excretion = 
  }}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}
 h Japanese (ja){{chembox
| Verifiedfields = changed
| verifiedrevid = 477317096
| ImageFile=alfacalcidol.png
| ImageFile2=Alfacalcidol ball-and-stick.png
| PIN=(1''R'',3''S'',5''Z'')-4-Methylidene-5-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]octahydro-4''H''-inden-4-ylidene}ethylidene]cyclohexane-1,3-diol
| OtherNames=Alphacalcidol; 1-Hydroxycholecalciferol
|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = URQ2517572
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 31186
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 32540
| InChI = 1/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| InChIKey = OFHCOWSQAMBJIW-AVJTYSNKBM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OFHCOWSQAMBJIW-AVJTYSNKSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=41294-56-8
| PubChem=5282181
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445376
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01436
| SMILES = O[C@@H]1CC(\C(=C)[C@@H](O)C1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(C)C)C
}}
|Section2={{Chembox Properties
| Formula=C<sub>27</sub>H<sub>44</sub>O<sub>2</sub>
| MolarMass=400.64 g/mol
| Appearance=
| Density=
| MeltingPtC= 136
| BoilingPt=
| Solubility= 0.016 g/100 mL
  }}
| Section6 = {{Chembox Pharmacology
| Pharmacology_ref = 
| ATCCode_prefix = A11
| ATCCode_suffix = CC03
| ATC_Supplemental = 
| ATCvet = 
| Licence_EU = yes
| INN = 
| INN_EMA = 
| Licence_US = 
| Legal_status = 
| Legal_AU = 
| Legal_AU_comment = 
| Legal_CA = 
| Legal_CA_comment = 
| Legal_NZ = 
| Legal_NZ_comment = 
| Legal_UK = POM
| Legal_UK_comment = 
| Legal_US = 
| Legal_US_comment = 
| Legal_EU = Rx-only
| Legal_EU_comment = 
| Legal_UN = 
| Legal_UN_comment = 
| Pregnancy_category = 
| Pregnancy_AU = 
| Pregnancy_AU_comment = 
| Dependence_liability = 
| AdminRoutes = 
| Bioavail = 
| ProteinBound = 
| Metabolism = 
| Metabolites = 
| OnsetOfAction = 
| HalfLife = 
| DurationOfAction = 
| Excretion = 
  }}
|Section7={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}