Translations:Ethyl eicosapentaenoic acid/6/en: Difference between revisions

From Azupedia
Jump to navigation Jump to search
FuzzyBot (talk | contribs)
Importing a new version from external source
 
(No difference)

Latest revision as of 19:16, 15 April 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Ethyl eicosapentaenoic acid)
<!-- Chemical and physical data -->
| IUPAC_name        = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate
| C=22 | H=34 | O=2
| SMILES            = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC
| StdInChI_Ref      = {{stdinchicite|changed|chemspider}}
| StdInChI          = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17-
| StdInChI_comment  = 
| StdInChIKey_Ref  = {{stdinchicite|changed|chemspider}}
| StdInChIKey      = SSQPWTVBQMWLSZ-AAQCHOMXSA-N
| density          = 
| density_notes    = 
| melting_point    = 
| melting_high      = 
| melting_notes    = 
| boiling_point    = 
| boiling_notes    = 
| solubility        = 
| sol_units        = 
| specific_rotation = 
}}

| IUPAC_name = Ethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref =  ☒N | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment = | StdInChIKey_Ref =  ☒N | StdInChIKey = SSQPWTVBQMWLSZ-AAQCHOMXSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}