Translations:Folate/6/en: Difference between revisions

From Azupedia
Jump to navigation Jump to search
FuzzyBot (talk | contribs)
Importing a new version from external source
 
(No difference)

Latest revision as of 13:48, 5 April 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Folate)
<!-- Chemical and physical data -->
| IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>4-[(2-Amino-4-oxo-1''H''-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid
| C = 19 | H = 19 | N = 7 | O = 6
| SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O
| StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1
| StdInChI_comment = 
| StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N
| density = 1.6±0.1
| density_notes = 
| melting_point = 250
| melting_high = 
| melting_notes = (decomposition)
| boiling_point = 
| boiling_notes = 
| solubility = 1.6
| sol_units = mg/L (25 °C)
| specific_rotation = 
}}

| IUPAC_name = (2S)-2-[[4-[(2-Amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | C = 19 | H = 19 | N = 7 | O = 6 | SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O | StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 | StdInChI_comment = | StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N | density = 1.6±0.1 | density_notes = | melting_point = 250 | melting_high = | melting_notes = (decomposition) | boiling_point = | boiling_notes = | solubility = 1.6 | sol_units = mg/L (25 °C) | specific_rotation = }}