Translations:Pyridoxal phosphate/1/en: Difference between revisions

From Azupedia
Jump to navigation Jump to search
VisualWikitext
FuzzyBot (talk | contribs)
15,166 edits
Importing a new version from external source
 
(No difference)

Latest revision as of 21:34, 3 April 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Pyridoxal phosphate)
{{short description|Active form of vitamin B6}}
{{chembox
| Verifiedfields = changed
| verifiedrevid = 393759663
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Pyridoxal-phosphate.svg
| ImageSize =
| ImageName = Skeletal formula
| ImageCaption = Idealised [[skeletal formula]]
| ImageFile1 = Pyridoxal-phosphate-from-xtal-3D-bs-17.png
| ImageSize1 = 210px
| ImageName1 = Ball-and-stick model
| ImageCaption1 = [[Ball-and-stick model]] based on the [[crystal structure]]. Note that the phosphate and [[pyridine]] groups have reacted to form a [[zwitterion]] and the [[aldehyde]] group is [[Geminal diol|hydrated]].
| PIN =(4-Formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate
| OtherNames = Pyridoxal 5-phosphate, PAL-P, PLP, Vitamin B6 phosphate
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 5249
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =54-47-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F06SGE49M6
| PubChem =1051
| ChEBI = 18405
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 82202
| SMILES = O=Cc1c(O)c(C)ncc1COP(O)(O)=O
| MeSHName =Pyridoxal+Phosphate
  }}
|Section2={{Chembox Properties
| Formula =C<sub>8</sub>H<sub>10</sub>NO<sub>6</sub>P
| MolarMass =247.142 g/mol
| Appearance =
| Density =1.638±0.06 g/cm3
| MeltingPtC = 139 to 142
| MeltingPt_ref = 
| BoilingPt =
| Solubility =
| pKa =1.56
  }}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = A11
| ATCCode_suffix = HA06
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =296.0±32.9 °C
| AutoignitionPt =
 }}
}}
Pyridoxal phosphate/1/en
Skeletal formula
Ball-and-stick model
Ball-and-stick model based on the crystal structure. Note that the phosphate and pyridine groups have reacted to form a zwitterion and the aldehyde group is hydrated.
Names
Preferred IUPAC name
(4-Formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate
Other names
Pyridoxal 5-phosphate, PAL-P, PLP, Vitamin B6 phosphate
Identifiers
3D model (JSmol)
ChEBI
ChEMBL
MeSH Pyridoxal+Phosphate
UNII
Properties
C8H10NO6P
Molar mass 247.142 g/mol
Density 1.638±0.06 g/cm3
Melting point 139 to 142 °C (282 to 288 °F; 412 to 415 K)
Acidity (pKa) 1.56
Pharmacology
A11HA06 (WHO)
Hazards
Flash point 296.0±32.9 °C
Tracking categories (test):
Retrieved from "https://wiki.tiffa.net/w/index.php?title=Translations:Pyridoxal_phosphate/1/en&oldid=134304"