Translations:Sitagliptin/6/en: Difference between revisions
Jump to navigation
Jump to search
Importing a new version from external source |
(No difference)
|
Latest revision as of 20:17, 12 March 2024
| IUPAC_name = (R)-4-oxo-4-[3-(trifluoromethyl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine
| C=16 | H=15 | F=6 | N=5 | O=1
| SMILES = Fc1cc(c(F)cc1F)C[C@@H](N)CC(=O)N3Cc2nnc(n2CC3)C(F)(F)F
| StdInChI_Ref =
| StdInChI = 1S/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2/t9-/m1/s1
| StdInChI_comment =
| StdInChIKey_Ref =
| StdInChIKey = MFFMDFFZMYYVKS-SECBINFHSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}