All translations
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!-- Chemical data --> | IUPAC_name = 2-(4-<nowiki/>{[4-Methyl-6-(1-methyl-1''H''-1,3-benzodiazol-2-yl)-2-propyl-1''H''-1,3-benzodiazol-1-yl]methyl}phenyl)benzoic acid | C=33 | H=30 | N=4 | O=2 | smiles = O=C(O)c1ccccc1c2ccc(cc2)Cn3c4cc(cc(c4nc3CCC)C)c5nc6ccccc6n5C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = RMMXLENWKUUMAY-UHFFFAOYSA-N }} |
| h Japanese (ja) | <!-- Chemical data --> | IUPAC_name = 2-(4-<nowiki/>{[4-Methyl-6-(1-methyl-1''H''-1,3-benzodiazol-2-yl)-2-propyl-1''H''-1,3-benzodiazol-1-yl]methyl}phenyl)benzoic acid | C=33 | H=30 | N=4 | O=2 | smiles = O=C(O)c1ccccc1c2ccc(cc2)Cn3c4cc(cc(c4nc3CCC)C)c5nc6ccccc6n5C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = RMMXLENWKUUMAY-UHFFFAOYSA-N }} |