All translations
Enter a message name below to show all available translations.
Found 2 translations.
Name | Current message text |
---|---|
h English (en) | <!-- Chemical and physical data --> | IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>4-[(2-Amino-4-oxo-1''H''-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | C = 19 | H = 19 | N = 7 | O = 6 | SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O | StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 | StdInChI_comment = | StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N | density = 1.6±0.1 | density_notes = | melting_point = 250 | melting_high = | melting_notes = (decomposition) | boiling_point = | boiling_notes = | solubility = 1.6 | sol_units = mg/L (25 °C) | specific_rotation = }} |
h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>4-[(2-Amino-4-oxo-1''H''-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | C = 19 | H = 19 | N = 7 | O = 6 | SMILES = n1c2C(=O)NC(N)=Nc2ncc1CNc3ccc(cc3)C(=O)N[C@H](C(O)=O)CCC(O)=O | StdInChI = 1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 | StdInChI_comment = | StdInChIKey = OVBPIULPVIDEAO-LBPRGKRZSA-N | density = 1.6±0.1 | density_notes = | melting_point = 250 | melting_high = | melting_notes = (decomposition) | boiling_point = | boiling_notes = | solubility = 1.6 | sol_units = mg/L (25 °C) | specific_rotation = }} |