All translations
Enter a message name below to show all available translations.
Found 2 translations.
| Name | Current message text |
|---|---|
| h English (en) | <!-- Chemical and physical data --> | IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = SSQPWTVBQMWLSZ-AAQCHOMXSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |
| h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = Ethyl (5''Z'',8''Z'',11''Z'',14''Z'',17''Z'')-icosa-5,8,11,14,17-pentaenoate | C=22 | H=34 | O=2 | SMILES = CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h5-6,8-9,11-12,14-15,17-18H,3-4,7,10,13,16,19-21H2,1-2H3/b6-5-,9-8-,12-11-,15-14-,18-17- | StdInChI_comment = | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = SSQPWTVBQMWLSZ-AAQCHOMXSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} |