All translations
Enter a message name below to show all available translations.
Found 2 translations.
Name | Current message text |
---|---|
h English (en) | <!-- Chemical and physical data --> | IUPAC_name = (3''S'',5''Z'',7''E'',22''E'')-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol | C=28 | H=44 | O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@H](C)C(C)C)C)C | StdInChI = 1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MECHNRXZTMCUDQ-RKHKHRCZSA-N | density = | density_notes = | melting_point = 114 | melting_high = 118 | melting_notes = | boiling_point = | boiling_notes = | solubility = | specific_rotation = }} |
h Japanese (ja) | <!-- Chemical and physical data --> | IUPAC_name = (3''S'',5''Z'',7''E'',22''E'')-9,10-secoergosta-5,7,10(19),22-tetraen-3-ol | C=28 | H=44 | O=1 | SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@H](C)C(C)C)C)C | StdInChI = 1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MECHNRXZTMCUDQ-RKHKHRCZSA-N | density = | density_notes = | melting_point = 114 | melting_high = 118 | melting_notes = | boiling_point = | boiling_notes = | solubility = | specific_rotation = }} |