All translations

Jump to navigation Jump to search

Enter a message name below to show all available translations.

Message

Found 2 translations.

NameCurrent message text
 h English (en){{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476998694
| ImageFile =calcium lactate.png
| ImageSize = 
| PIN =Calcium bis(2-hydroxypropanoate)
| OtherNames = {{Unbulleted list
  | calcium lactate 5-hydrate
  | calcium lactate
  | 2-hydroxypropanoic acid
  | calcium salt pentahydrate
  }}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12592
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2URQ2N32W3
| InChI = 1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
| InChIKey = MKJXYGKVIBWPFZ-NUQVWONBAM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MKJXYGKVIBWPFZ-UHFFFAOYSA-L
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =814-80-2
| PubChem =13144
| EC_number = 212-406-7
| DrugBank = DB13231
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 2106111
| SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C
}}
|Section2={{Chembox Properties
| Formula =C<sub>6</sub>H<sub>10</sub>CaO<sub>6</sub>
| MolarMass =218.22 g/mol
| Appearance = white or off-white powder, slightly [[efflorescent]]
| Density = 1.494 g/cm<sup>3</sup>
| MeltingPtC = 240
| MeltingPt_notes = (anhydrous) <br> 120 °C (pentahydrate)
| BoilingPt =
| Solubility = L-lactate, anhydrous, g/100 mL: 4.8 (10 °C), 5.8 (20 °C), 6.7 (25 °C), 8.5 (30 °C); 7.9 g/100 mL (30 °C)
| SolubleOther = very soluble in [[methanol]], insoluble in [[ethanol]]
| pKa = 6.0-8.5
| RefractIndex = 1.470
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = A12
| ATCCode_suffix = AA05
}}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|319}}
| PPhrases = {{P-phrases|264|280|305+351+338|337+313}}
| MainHazards =
| FlashPt = Not applicable
| AutoignitionPt = No data
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
}}
}}
 h Japanese (ja){{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476998694
| ImageFile =calcium lactate.png
| ImageSize = 
| PIN =Calcium bis(2-hydroxypropanoate)
| OtherNames = {{Unbulleted list
  | calcium lactate 5-hydrate
  | calcium lactate
  | 2-hydroxypropanoic acid
  | calcium salt pentahydrate
  }}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12592
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2URQ2N32W3
| InChI = 1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
| InChIKey = MKJXYGKVIBWPFZ-NUQVWONBAM
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MKJXYGKVIBWPFZ-UHFFFAOYSA-L
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo =814-80-2
| PubChem =13144
| EC_number = 212-406-7
| DrugBank = DB13231
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 2106111
| SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C
}}
|Section2={{Chembox Properties
| Formula =C<sub>6</sub>H<sub>10</sub>CaO<sub>6</sub>
| MolarMass =218.22 g/mol
| Appearance = white or off-white powder, slightly [[efflorescent]]
| Density = 1.494 g/cm<sup>3</sup>
| MeltingPtC = 240
| MeltingPt_notes = (anhydrous) <br> 120 °C (pentahydrate)
| BoilingPt =
| Solubility = L-lactate, anhydrous, g/100 mL: 4.8 (10 °C), 5.8 (20 °C), 6.7 (25 °C), 8.5 (30 °C); 7.9 g/100 mL (30 °C)
| SolubleOther = very soluble in [[methanol]], insoluble in [[ethanol]]
| pKa = 6.0-8.5
| RefractIndex = 1.470
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = A12
| ATCCode_suffix = AA05
}}
|Section7={{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|319}}
| PPhrases = {{P-phrases|264|280|305+351+338|337+313}}
| MainHazards =
| FlashPt = Not applicable
| AutoignitionPt = No data
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
}}
}}