Translations:Flavin mononucleotide/1/en: Difference between revisions

From Azupedia
Jump to navigation Jump to search
VisualWikitext
FuzzyBot (talk | contribs)
14,847 edits
Importing a new version from external source
 
(No difference)

Latest revision as of 15:19, 10 April 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Flavin mononucleotide)
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461100522
| ImageFile = Flavin mononucleotide v2.svg
| ImageSize = 180
| ImageAlt = Skeletal formula of flavin mononucleotide
| ImageFile1 = Flavin mononucleotide 3D ball.png
| ImageSize1 = 180
| ImageAlt1 = Ball-and-stick model of the flavin mononucleotide molecule
| IUPACName = 1-Deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[''g'']pteridin-10(2''H'')-yl)-<small>D</small>-ribitol 5-(dihydrogen phosphate)
| SystematicName = (2''R'',3''S'',4''S'')-5-(7,8-Dimethyl-2,4-dioxo-3,4-dihydrobenzo[''g'']pteridin-10(2''H'')-yl)-2,3,4-trihydroxypentyl dihydrogen phosphate
| OtherNames = {{Unbulleted list|FMN}}
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 5185
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 559060
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7N464URE7E
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H21N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29)/t11-,12+,14-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FVTCRASFADXXNN-SCRDCRAPSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 146-17-8
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 130-40-5
| CASNo2_Comment = (sodium salt)
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201794
| PubChem = 643976
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17621
| SMILES = Cc1cc2c(cc1C)n(c-3nc(=O)[nH]c(=O)c3n2)C[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O
| MeSHName = Flavin+mononucleotide
  }}
|Section2={{Chembox Properties
| Formula = C<sub>17</sub>H<sub>21</sub>N<sub>4</sub>O<sub>9</sub>P
| MolarMass = 456.344 g/mol
| Appearance = 
| Density = 
| MeltingPt = 195 °C
| BoilingPt = 
  }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
  }}
}}
'''Flavin mononucleotide''' ('''FMN'''), or '''riboflavin-5′-phosphate''', is a [[biomolecule]] produced from [[riboflavin]] (vitamin B<sub>2</sub>) by the enzyme [[riboflavin kinase]] and functions as the [[prosthetic group]] of various [[oxidoreductase]]s, including [[NADH dehydrogenase]], as well as cofactor in biological blue-light photo receptors. During the catalytic cycle, a reversible interconversion of the oxidized (FMN), semiquinone (FMNH<sup>•</sup>), and reduced (FMNH<sub>2</sub>) forms occurs in the various oxidoreductases. FMN is a stronger oxidizing agent than [[Nicotinamide adenine dinucleotide|NAD]] and is particularly useful because it can take part in both one- and two-electron transfers. In its role as blue-light photo receptor, (oxidized) FMN stands out from the 'conventional' photo receptors as the signaling state and not an E/Z isomerization.
Flavin mononucleotide/1/en
Skeletal formula of flavin mononucleotide
Ball-and-stick model of the flavin mononucleotide molecule
Names
IUPAC name
1-Deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol 5-(dihydrogen phosphate)
Systematic IUPAC name
(2R,3S,4S)-5-(7,8-Dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-2,3,4-trihydroxypentyl dihydrogen phosphate
Other names
  • FMN
Identifiers
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
MeSH Flavin+mononucleotide
UNII
Properties
C17H21N4O9P
Molar mass 456.344 g/mol
Melting point 195 °C
Tracking categories (test):

Flavin mononucleotide (FMN), or riboflavin-5′-phosphate, is a biomolecule produced from riboflavin (vitamin B2) by the enzyme riboflavin kinase and functions as the prosthetic group of various oxidoreductases, including NADH dehydrogenase, as well as cofactor in biological blue-light photo receptors. During the catalytic cycle, a reversible interconversion of the oxidized (FMN), semiquinone (FMNH•), and reduced (FMNH2) forms occurs in the various oxidoreductases. FMN is a stronger oxidizing agent than NAD and is particularly useful because it can take part in both one- and two-electron transfers. In its role as blue-light photo receptor, (oxidized) FMN stands out from the 'conventional' photo receptors as the signaling state and not an E/Z isomerization.

Retrieved from "https://wiki.tiffa.net/w/index.php?title=Translations:Flavin_mononucleotide/1/en&oldid=136749"