Translations:Methylcobalamin/4/en

| CAS_number_Ref =  ^Y | CAS_number = 13422-55-4 | ATC_prefix = B03 | ATC_suffix = BA05 | PubChem = 6436232 | ChemSpiderID = 29368587 | DrugBank_Ref =  ^Y | DrugBank = | UNII_Ref =  ^N | UNII = BR1SN1JS2W | ChEMBL_Ref =  ^N | ChEMBL = 1697757 | StdInChI=1S/C62H90N13O14P.CH3.Co/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H15,63,64,65,66,67,68,69,71,72,73,74,77,78,79,80,81,82,83,85,86);1H3;/q;-1;+3/p-2 | StdInChIKey = ZFLASALABLFSNM-UHFFFAOYSA-L | SMILES = [CH3-].CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C(C(C(=N7)C=C8C(C(C(=N8)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[Co+3] | C=63 | H=91 | Co=1 | N=13 | O=14 | P=1 |drug_name=|alt=|caption=|type=|MedlinePlus=|licence_EU=|licence_US=}} Methylcobalamin (mecobalamin, MeCbl, or MeB₁₂) is a cobalamin, a form of vitamin B₁₂. It differs from cyanocobalamin in that the cyano group at the cobalt is replaced with a methyl group. Methylcobalamin features an octahedral cobalt(III) centre and can be obtained as bright red crystals. From the perspective of coordination chemistry, methylcobalamin is notable as a rare example of a compound that contains metal–alkyl bonds. Nickel–methyl intermediates have been proposed for the final step of methanogenesis.