Translations:Thiamine/1/en: Difference between revisions

From Azupedia
Jump to navigation Jump to search
VisualWikitext
FuzzyBot (talk | contribs)
15,166 edits
Importing a new version from external source
Tags: Mobile edit Mobile web edit
 
(No difference)

Latest revision as of 11:12, 19 February 2024

Information about message (contribute)
This message has no documentation. If you know where or how this message is used, you can help other translators by adding documentation to this message.
Message definition (Thiamine)
{{Pathnav|Dietary supplement|Vitamin|frame=1}}
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name          =
| INN                =
| type              = <!-- empty -->
| IUPAC_name        = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol
| image              = Thiamin.svg
| width              =
| alt                =
| image2            = Thiamine-cation-from-xtal-3D-bs-17.png
| width2            =
| alt2              =
| imageL            =
| widthL            =
| altL              =
| imageR            =
| widthR            =
| altR              =
| caption            = Skeletal formula and ball-and-stick model of the thiamine [[Ion#Anions and cations|cation]]
<!-- Clinical data -->| pronounce          = {{IPAc-en|ˈ|θ|aɪ|.|ə|m|ᵻ|n}} {{respell|THY|ə-min}}
| tradename          =
| Drugs.com          = {{Drugs.com|monograph|thiamine-hydrochloride}}
| MedlinePlus        =
| licence_EU        = <!-- EMA requires brand name -->
| licence_US        = Thiamine
| DailyMedID        = Thiamine
| pregnancy_AU      = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration = by mouth, IV, IM
| legal_AU          = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment  =
| legal_CA          = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment  =
| legal_DE          = <!-- Anlage I, II, III or Unscheduled-->
| legal_DE_comment  =
| legal_NZ          = <!-- Class A, B, C -->
| legal_NZ_comment  =
| legal_UK          = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment  =
| legal_US          = OTC
| legal_US_comment  =
| legal_UN          = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_UN_comment  =
| legal_status      = <!--For countries not listed above-->
<!-- Pharmacokinetic data -->| bioavailability = 3.7% to 5.3% (Thiamine hydrochloride)
| protein_bound      =
| metabolism        =
| metabolites        =
| onset              =
| elimination_half-life =
| duration_of_action =
| excretion          = <!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 70-16-6
| index_label = cation
| index2_label = Cl<sup>−</sup> salt
| CAS_number2_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 59-43-8 
| CAS_supplemental =<br>{{CAS|67-03-8}}(Cl<sup>−</sup>.HCl)
| UNII2_Ref = {{fdacite|correct|FDA}}
| UNII2 = X66NSO3N35
| class              = [[vitamin]]
| ATCvet            =
| ATC_prefix        = A11
| ATC_suffix        = DA01
| ATC_supplemental  =
| PubChem            = 1130
| PubChem2  = 6042
| IUPHAR_ligand      =
| DrugBank          = DB00152
| ChemSpiderID      = 1098
| UNII              = 4ABT0J945J
| KEGG              = C00378
| ChEBI              = 18385
| ChEMBL            = 1547
| NIAID_ChemDB      =
| synonyms          = Vitamin B<sub>1</sub>, aneurine, thiamin
<!-- Chemical and physical data -->| chemical_formula  = | C= 12| H= 17| N= 4| O= 1| S= 1
| charge            = +
| SMILES            = Cc2ncc(C[n+]1csc(CCO)c1C)c(N)n2
| Jmol              =
| StdInChI          = 1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1
| StdInChI_Ref      = {{stdinchicite|correct|chemspider}}
| StdInChIKey        = JZRWCGZRTZMZEH-UHFFFAOYSA-N
<!--| InChIKey1 = MYVIATVLJGTBFV-UHFFFAOYSA-M
| InChIKey2 = DPJRMOMPQZCRJU-UHFFFAOYSA-M
 StdInChI and key are for cation, extra Inchikey for Cl- salt and Cl-.HCl, so search engines will find this page. Source=CAS  -->
| density            =
| density_notes      =
| melting_point      =
| melting_high      =
| melting_notes      =
| boiling_point      =
| boiling_notes      =
| solubility        =
| specific_rotation  =
}}
Dietary supplement > Vitamin > Thiamine/1/en
Thiamine/1/en
Skeletal formula and ball-and-stick model of the thiamine cation
Clinical data
Pronunciation/ˈθaɪ.əmɪn/ THY-ə-min
Other namesVitamin B1, aneurine, thiamin
AHFS/Drugs.comMonograph
License data
Routes of
administration		by mouth, IV, IM
Drug classvitamin
ATC code
Legal status
Legal status
Pharmacokinetic data
Bioavailability3.7% to 5.3% (Thiamine hydrochloride)
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC12H17N4OS+
Molar mass265.36 g·mol−1
3D model (JSmol)
Retrieved from "https://wiki.tiffa.net/w/index.php?title=Translations:Thiamine/1/en&oldid=117028"