FuzzyBot: Importing a new version from external source

2024-04-10T05:55:07Z

Importing a new version from external source

New page

{{chembox
| Watchedfields = changed
| verifiedrevid = 470606241
| Name =
| ImageFile = Thiamine diphosphate.png
| ImageSize = 200px
| IUPACName = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate
| OtherNames = Thiamine diphosphate
| SystematicName =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10670483
| ChEBI = 9532
| KEGG = C00068
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q57971654Y
| InChI = 1/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1
| InChIKey = NBSUTVXQOGUTJX-REWHXWOFAB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NBSUTVXQOGUTJX-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 136-08-3
| PubChem = 1132
| SMILES = Cc2ncc(C[n+]1csc(CCOP(=O)(O)OP(=O)(O)O)c1C)c(N)n2
| MeSHName = Thiamine+pyrophosphate
}}
| Section2 = {{Chembox Properties
| Formula = C12H19N4O7P2S+
| MolarMass = 425.314382 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
| Section4 =
| Section5 =
| Section6 =
}}
'''Thiamine pyrophosphate''' ('''TPP''' or '''ThPP'''), or '''thiamine diphosphate''' ('''ThDP'''), or '''cocarboxylase''' is a [[thiamine]] (vitamin B1) [[Derivative (chemistry)|derivative]] which is produced by the [[enzyme]] [[thiamine diphosphokinase]]. Thiamine pyrophosphate is a [[cofactor (biochemistry)|cofactor]] that is present in all living systems, in which it catalyzes several [[Biochemistry|biochemical]] reactions.

Translations:Thiamine pyrophosphate/1/en - Revision history

FuzzyBot: Importing a new version from external source