https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3AThiamine%2F1%2Fen
Translations:Thiamine/1/en - Revision history
2026-05-11T04:05:40Z
Revision history for this page on the wiki
MediaWiki 1.43.0
https://wiki.tiffa.net/w/index.php?title=Translations:Thiamine/1/en&diff=117028&oldid=prev
FuzzyBot: Importing a new version from external source
2024-02-19T02:12:09Z
<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{Pathnav|Dietary supplement|Vitamin|frame=1}}<br />
{{Short description|Chemical compound}}<br />
{{Infobox drug<br />
| drug_name =<br />
| INN =<br />
| type = <!-- empty --><br />
| IUPAC_name = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol<br />
| image = Thiamin.svg<br />
| width =<br />
| alt =<br />
| image2 = Thiamine-cation-from-xtal-3D-bs-17.png<br />
| width2 =<br />
| alt2 =<br />
| imageL =<br />
| widthL =<br />
| altL =<br />
| imageR =<br />
| widthR =<br />
| altR =<br />
| caption = Skeletal formula and ball-and-stick model of the thiamine [[Ion#Anions and cations|cation]]<br />
<!-- Clinical data -->| pronounce = {{IPAc-en|ˈ|θ|aɪ|.|ə|m|ᵻ|n}} {{respell|THY|ə-min}}<br />
| tradename =<br />
| Drugs.com = {{Drugs.com|monograph|thiamine-hydrochloride}}<br />
| MedlinePlus =<br />
| licence_EU = <!-- EMA requires brand name --><br />
| licence_US = Thiamine<br />
| DailyMedID = Thiamine<br />
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X --><br />
| pregnancy_AU_comment =<br />
| pregnancy_category =<br />
| dependency_liability =<br />
| addiction_liability =<br />
| routes_of_administration = by mouth, IV, IM<br />
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--><br />
| legal_AU_comment =<br />
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --><br />
| legal_CA_comment =<br />
| legal_DE = <!-- Anlage I, II, III or Unscheduled--><br />
| legal_DE_comment =<br />
| legal_NZ = <!-- Class A, B, C --><br />
| legal_NZ_comment =<br />
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --><br />
| legal_UK_comment =<br />
| legal_US = OTC<br />
| legal_US_comment =<br />
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV--><br />
| legal_UN_comment =<br />
| legal_status = <!--For countries not listed above--><br />
<!-- Pharmacokinetic data -->| bioavailability = 3.7% to 5.3% (Thiamine hydrochloride)<br />
| protein_bound =<br />
| metabolism =<br />
| metabolites =<br />
| onset =<br />
| elimination_half-life =<br />
| duration_of_action =<br />
| excretion = <!-- Identifiers --><br />
| CAS_number_Ref = {{cascite|correct|CAS}}<br />
| CAS_number = 70-16-6<br />
| index_label = cation<br />
| index2_label = Cl<sup>−</sup> salt<br />
| CAS_number2_Ref = {{cascite|correct|CAS}}<br />
| CAS_number2 = 59-43-8 <br />
| CAS_supplemental =<br>{{CAS|67-03-8}}(Cl<sup>−</sup>.HCl)<br />
| UNII2_Ref = {{fdacite|correct|FDA}}<br />
| UNII2 = X66NSO3N35<br />
| class = [[vitamin]]<br />
| ATCvet =<br />
| ATC_prefix = A11<br />
| ATC_suffix = DA01<br />
| ATC_supplemental =<br />
| PubChem = 1130<br />
| PubChem2 = 6042<br />
| IUPHAR_ligand =<br />
| DrugBank = DB00152<br />
| ChemSpiderID = 1098<br />
| UNII = 4ABT0J945J<br />
| KEGG = C00378<br />
| ChEBI = 18385<br />
| ChEMBL = 1547<br />
| NIAID_ChemDB =<br />
| synonyms = Vitamin B<sub>1</sub>, aneurine, thiamin<br />
<!-- Chemical and physical data -->| chemical_formula = | C= 12| H= 17| N= 4| O= 1| S= 1<br />
| charge = +<br />
| SMILES = Cc2ncc(C[n+]1csc(CCO)c1C)c(N)n2<br />
| Jmol =<br />
| StdInChI = 1S/C12H17N4OS/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15)/q+1<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = JZRWCGZRTZMZEH-UHFFFAOYSA-N<br />
<!--| InChIKey1 = MYVIATVLJGTBFV-UHFFFAOYSA-M<br />
| InChIKey2 = DPJRMOMPQZCRJU-UHFFFAOYSA-M<br />
StdInChI and key are for cation, extra Inchikey for Cl- salt and Cl-.HCl, so search engines will find this page. Source=CAS --><br />
| density =<br />
| density_notes =<br />
| melting_point =<br />
| melting_high =<br />
| melting_notes =<br />
| boiling_point =<br />
| boiling_notes =<br />
| solubility =<br />
| specific_rotation =<br />
}}</div>
FuzzyBot