https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3APyridoxal_phosphate%2F1%2Fen 2026-05-12T06:33:49Z Revision history for this page on the wiki MediaWiki 1.43.0 https://wiki.tiffa.net/w/index.php?title=Translations:Pyridoxal_phosphate/1/en&diff=134304&oldid=prev 2024-04-03T12:34:50Z

<p>Importing a new version from external source</p> <p><b>New page</b></p><div>{{short description|Active form of vitamin B6}}<br /> {{chembox<br /> | Verifiedfields = changed<br /> | verifiedrevid = 393759663<br /> | ImageFile_Ref = {{chemboximage|correct|??}}<br /> | ImageFile = Pyridoxal-phosphate.svg<br /> | ImageSize =<br /> | ImageName = Skeletal formula<br /> | ImageCaption = Idealised [[skeletal formula]]<br /> | ImageFile1 = Pyridoxal-phosphate-from-xtal-3D-bs-17.png<br /> | ImageSize1 = 210px<br /> | ImageName1 = Ball-and-stick model<br /> | ImageCaption1 = [[Ball-and-stick model]] based on the [[crystal structure]]. Note that the phosphate and [[pyridine]] groups have reacted to form a [[zwitterion]] and the [[aldehyde]] group is [[Geminal diol|hydrated]].<br /> | PIN =(4-Formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate<br /> | OtherNames = Pyridoxal 5-phosphate, PAL-P, PLP, Vitamin B6 phosphate<br /> |Section1={{Chembox Identifiers<br /> | IUPHAR_ligand = 5249<br /> | CASNo_Ref = {{cascite|correct|CAS}}<br /> | CASNo =54-47-7<br /> | UNII_Ref = {{fdacite|correct|FDA}}<br /> | UNII = F06SGE49M6<br /> | PubChem =1051<br /> | ChEBI = 18405<br /> | ChEMBL_Ref = {{ebicite|changed|EBI}}<br /> | ChEMBL = 82202<br /> | SMILES = O=Cc1c(O)c(C)ncc1COP(O)(O)=O<br /> | MeSHName =Pyridoxal+Phosphate<br /> }}<br /> |Section2={{Chembox Properties<br /> | Formula =C&lt;sub&gt;8&lt;/sub&gt;H&lt;sub&gt;10&lt;/sub&gt;NO&lt;sub&gt;6&lt;/sub&gt;P<br /> | MolarMass =247.142 g/mol<br /> | Appearance =<br /> | Density =1.638±0.06 g/cm3<br /> | MeltingPtC = 139 to 142<br /> | MeltingPt_ref = <br /> | BoilingPt =<br /> | Solubility =<br /> | pKa =1.56<br /> }}<br /> |Section6={{Chembox Pharmacology<br /> | ATCCode_prefix = A11<br /> | ATCCode_suffix = HA06<br /> }}<br /> |Section7={{Chembox Hazards<br /> | MainHazards =<br /> | FlashPt =296.0±32.9 °C<br /> | AutoignitionPt =<br /> }}<br /> }}</div>

FuzzyBot