https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3APantothenic_acid%2F1%2Fen
Translations:Pantothenic acid/1/en - Revision history
2026-05-11T04:05:44Z
Revision history for this page on the wiki
MediaWiki 1.43.0
https://wiki.tiffa.net/w/index.php?title=Translations:Pantothenic_acid/1/en&diff=118127&oldid=prev
FuzzyBot: Importing a new version from external source
2024-02-20T07:47:08Z
<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{Short description|chemical compound}}<br />
{{Pathnav|Dietary supplement|Vitamin|frame=1}}<br />
{{Chembox<br />
| Verifiedfields = changed<br />
| Watchedfields = changed<br />
| verifiedrevid = 477003091<br />
| ImageFile = (R)-Pantothenic acid Formula V.1.svg<br />
| ImageSize =<br />
| ImageName = Skeletal formula of (R)-pantothenic acid<br />
| ImageFile1 = Pantothenic-acid-based-on-xtal-3D-bs-17.png<br />
| ImageSize1 =<br />
| ImageName1 = Pantothenic acid molecule<br />
| PIN = 3-[(2''R'')-2,4-Dihydroxy-3,3-dimethylbutanamido]propanoic acid<br />
| SystematicName = 3-[(2''R'')-(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid<br />
|Section1={{Chembox Identifiers<br />
| CASNo = 599-54-2<br />
| CASNo_Ref = {{cascite|correct|CAS}}<br />
| CASNo1 = 79-83-4<br />
| CASNo1_Comment = (''R'')<br />
| CASNo1_Ref = {{cascite|correct|CAS}}<br />
| PubChem = 988<br />
| PubChem1 = 6613<br />
| PubChem1_Comment = (''R'')<br />
| PubChem2 = 5748353<br />
| PubChem2_Comment = (''S'')<br />
| ChemSpiderID = 963<br />
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}<br />
| ChemSpiderID1 = 6361<br />
| ChemSpiderID1_Comment = (''R'')<br />
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}}<br />
| ChemSpiderID2 = 4677898<br />
| ChemSpiderID2_Comment = (''S'')<br />
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = 66Y94D1203<br />
| UNII1 = 19F5HK2737<br />
| UNII1_Ref = {{fdacite|correct|FDA}}<br />
| UNII1_Comment = (''R'')<br />
| EC_number = 209-965-4<br />
| DrugBank = DB01783<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| KEGG = D07413<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| MeSHName = Pantothenic+Acid<br />
| ChEBI = 7916<br />
| ChEBI_Ref = {{ebicite|changed|EBI}}<br />
| ChEMBL = 1594<br />
| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| Beilstein = 1727062, 1727064 (''R'')<br />
| 3DMet = B00193<br />
| SMILES = CC(C)(CO)C(C(=O)NCCC(=O)O)O<br />
| SMILES1 = CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O<br />
| SMILES1_Comment = (''R'')<br />
| SMILES2 = CC(C)(CO)[C@@H](C(=O)NCCC(=O)O)O<br />
| SMILES2_Comment = (''S'')<br />
| StdInChI = 1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)<br />
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChIKey = GHOKWGTUZJEAQD-UHFFFAOYSA-N<br />
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}<br />
| RTECS = RU4729000<br />
}}<br />
|Section2={{Chembox Properties<br />
| C=9 | H=17 | N=1 | O=5<br />
| Density = 1.266 g/cm<sup>3</sup><br/> 1.32 g/cm<sup>3</sup> (Ca<sup>2+</sup> salt)<br />
| Appearance = Yellow oil<br/> Colorless crystals (Ca<sup>2+</sup> salt)<br />
| Odor = Odorless<br />
| MeltingPtC = 183.833<br />
| MeltingPt_notes = <br/> {{convert|196-200|C|F K}}<br/> decomposes (Ca<sup>2+</sup> salt)<br />
| LogP = −1.416<br />
| pKa = 4.41<br />
| pKb = 9.698<br />
| Solubility = Very soluble<br />
| SolubleOther = Very soluble in [[benzene|C<sub>6</sub>H<sub>6</sub>]], [[diethyl ether|ether]]<br />
| SpecRotation = +37.5°<br/> +24.3° (Ca<sup>2+</sup> salt)<br />
}}<br />
|Section7={{Chembox Hazards<br />
| NFPA-H = 2<br />
| NFPA-F = 1<br />
| NFPA-R = 0<br />
| LD50 = > 10 mg/g (Ca<sup>2+</sup> salt)<br />
}}<br />
|Section9={{Chembox Related<br />
| OtherFunction_label = alkanoic acids<br />
| OtherFunction = [[Arginine]]<br/>[[Hopantenic acid]]<br/>[[4-(γ-Glutamylamino)butanoic acid]]<br />
| OtherCompounds = [[Panthenol]]<br />
}}<br />
}}</div>
FuzzyBot