<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3AOctotiamine%2F1%2Fja</id>
	<title>Translations:Octotiamine/1/ja - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3AOctotiamine%2F1%2Fja"/>
	<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Octotiamine/1/ja&amp;action=history"/>
	<updated>2026-08-20T21:53:57Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://wiki.tiffa.net/w/index.php?title=Translations:Octotiamine/1/ja&amp;diff=133308&amp;oldid=prev</id>
		<title>Fire: Created page with &quot;{{Drugbox | IUPAC_name        = methyl 6-(acetylsulfanyl)-8-&lt;nowiki/&gt;{[(2E)-2-&lt;nowiki/&gt;{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate | image             = Octotiamine.svg | width             = 250 | image2            = Octotiamine 3D.png | width2             = 160 | CAS_number        = 137-86-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UN1Q7096GA | ATC_prefix        = None | ATC_suffix        =  | PubChem...&quot;</title>
		<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Octotiamine/1/ja&amp;diff=133308&amp;oldid=prev"/>
		<updated>2024-04-03T01:33:22Z</updated>

		<summary type="html">&lt;p&gt;Created page with &amp;quot;{{Drugbox | IUPAC_name        = methyl 6-(acetylsulfanyl)-8-&amp;lt;nowiki/&amp;gt;{[(2E)-2-&amp;lt;nowiki/&amp;gt;{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate | image             = Octotiamine.svg | width             = 250 | image2            = Octotiamine 3D.png | width2             = 160 | CAS_number        = 137-86-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UN1Q7096GA | ATC_prefix        = None | ATC_suffix        =  | PubChem...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;{{Drugbox&lt;br /&gt;
| IUPAC_name        = methyl 6-(acetylsulfanyl)-8-&amp;lt;nowiki/&amp;gt;{[(2E)-2-&amp;lt;nowiki/&amp;gt;{[(4-amino-2-methyl-5-pyrimidinyl)methyl](formyl)amino}-5-hydroxy-2-penten-3-yl]disulfanyl}octanoate&lt;br /&gt;
| image             = Octotiamine.svg&lt;br /&gt;
| width             = 250&lt;br /&gt;
| image2            = Octotiamine 3D.png&lt;br /&gt;
| width2             = 160&lt;br /&gt;
| CAS_number        = 137-86-0&lt;br /&gt;
| UNII_Ref = {{fdacite|correct|FDA}}&lt;br /&gt;
| UNII = UN1Q7096GA&lt;br /&gt;
| ATC_prefix        = None&lt;br /&gt;
| ATC_suffix        = &lt;br /&gt;
| PubChem           = 3034020&lt;br /&gt;
| DrugBank          = &lt;br /&gt;
| ChemSpiderID      = 2298574&lt;br /&gt;
| chemical_formula =&lt;br /&gt;
| C=23 | H=36 | N=4 | O=5 | S=3 &lt;br /&gt;
| SMILES = Cc1ncc(c(n1)N)CN(C=O)/C(=C(\CCO)/SSCCC(CCCCC(=O)OC)SC(=O)C)/C&lt;br /&gt;
| StdInChI          = 1S/C23H36N4O5S3/c1-16(27(15-29)14-19-13-25-17(2)26-23(19)24)21(9-11-28)35-33-12-10-20(34-18(3)30)7-5-6-8-22(31)32-4/h13,15,20,28H,5-12,14H2,1-4H3,(H2,24,25,26)/b21-16+&lt;br /&gt;
| StdInChIKey       = VJTXQHYNRDGLON-LTGZKZEYSA-N&lt;br /&gt;
| bioavailability   = &lt;br /&gt;
| protein_bound     = &lt;br /&gt;
| metabolism        = &lt;br /&gt;
| elimination_half-life = &lt;br /&gt;
| excretion         = &lt;br /&gt;
| pregnancy_AU      =  &amp;lt;!-- A / B1 / B2 / B3 / C / D / X --&amp;gt;&lt;br /&gt;
| pregnancy_US      =  &amp;lt;!-- A / B            / C / D / X --&amp;gt;&lt;br /&gt;
| pregnancy_category=  &lt;br /&gt;
| legal_AU =  &amp;lt;!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--&amp;gt;&lt;br /&gt;
| legal_CA =  &amp;lt;!-- Schedule I, II, III, IV, V, VI, VII, VIII --&amp;gt;&lt;br /&gt;
| legal_UK =  &amp;lt;!-- GSL, P, POM, CD, or Class A, B, C --&amp;gt;&lt;br /&gt;
| legal_US =  &amp;lt;!-- OTC / Rx-only / Schedule I, II, III, IV, V --&amp;gt;&lt;br /&gt;
| legal_status      = &lt;br /&gt;
| routes_of_administration = &lt;br /&gt;
}}&lt;/div&gt;</summary>
		<author><name>Fire</name></author>
	</entry>
</feed>