https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3ANifedipine%2F1%2Fen
Translations:Nifedipine/1/en - Revision history
2026-07-11T14:10:43Z
Revision history for this page on the wiki
MediaWiki 1.43.0
https://wiki.tiffa.net/w/index.php?title=Translations:Nifedipine/1/en&diff=76366&oldid=prev
FuzzyBot: Importing a new version from external source
2023-11-15T12:36:46Z
<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{Pathnav|Medication|Antihypertensive drug|Calcium channel blocker|frame=1}}<br />
{{Short description|Calcium channel blocker medication}}<br />
{{Drugbox<br />
| verifiedrevid = 462260435<br />
| IUPAC_name = 3,5-dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate<br />
| imageL = Nifedipine.svg<br />
| imageR = Nifedipine-from-xtal-3D-balls.png<br />
| image2 = Nifedipine_substance_photo.jpg<br />
<!--Clinical data--><br />
| tradename = Adalat, Procardia, others<br />
| Drugs.com = {{drugs.com|monograph|nifedipine}}<br />
| MedlinePlus = a684028<br />
| DailyMedID = Nifedipine<br />
| pregnancy_AU = C<br />
| pregnancy_AU_comment = <br />
| pregnancy_category= <br />
| legal_status = <br />
| routes_of_administration = [[Oral administration|By mouth]], topical<br />
| class = [[Calcium channel blocker]] ([[dihydropyridine]])<br />
<!--Pharmacokinetic data--><br />
| bioavailability = 45-56%<br />
| protein_bound = 92-98%<br />
| metabolism = Gastrointestinal, Liver<br />
| elimination_half-life = 2 hours<br />
| excretion = Kidneys: >50%, Biliary: 5-15%<br />
<!--Identifiers--><br />
| CAS_number_Ref = {{cascite|correct|??}}<br />
| CAS_number = 21829-25-4<br />
| ATC_prefix = C08<br />
| ATC_suffix = CA05<br />
| ATC_supplemental = <br />
| PubChem = 4485<br />
| IUPHAR_ligand = 2514<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| DrugBank = DB01115<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| ChemSpiderID = 4330<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = I9ZF7L6G2L<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| KEGG = D00437<br />
| ChEBI_Ref = {{ebicite|correct|EBI}}<br />
| ChEBI = 7565<br />
| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| ChEMBL = 193<br />
<!--Chemical data--><br />
| C=17 | H=18 | N=2 | O=6<br />
| smiles = O=C(OC)\C1=C(\N/C(=C(/C(=O)OC)C1c2ccccc2[N+]([O-])=O)C)C<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI = 1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = HYIMSNHJOBLJNT-UHFFFAOYSA-N<br />
| melting_point = 173<br />
}}<br />
<!-- Definition and medical uses --><br />
'''Nifedipine''', sold under the brand names '''Adalat''' and '''Procardia''' among others, is a [[calcium channel blocker]] medication used to manage [[angina]], [[hypertension|high blood pressure]], [[Raynaud's phenomenon]], and [[premature labor]]. It is one of the treatments of choice for [[Prinzmetal angina]]. It may be used to treat severe [[high blood pressure in pregnancy]]. Its use in preterm labor may allow more time for [[corticosteroid|steroids]] to improve the baby's lung function and provide time for transfer of the mother to a well qualified medical facility before delivery. It is a calcium channel blocker of the [[Dihydropyridine calcium channel blockers|dihydropyridine]] type. Nifedipine is taken by mouth and comes in fast- and slow-release formulations.</div>
FuzzyBot