<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3ANifedipine%2F1%2Fen</id>
	<title>Translations:Nifedipine/1/en - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3ANifedipine%2F1%2Fen"/>
	<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Nifedipine/1/en&amp;action=history"/>
	<updated>2026-09-18T07:23:01Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://wiki.tiffa.net/w/index.php?title=Translations:Nifedipine/1/en&amp;diff=76366&amp;oldid=prev</id>
		<title>FuzzyBot: Importing a new version from external source</title>
		<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Nifedipine/1/en&amp;diff=76366&amp;oldid=prev"/>
		<updated>2023-11-15T12:36:46Z</updated>

		<summary type="html">&lt;p&gt;Importing a new version from external source&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;{{Pathnav|Medication|Antihypertensive drug|Calcium channel blocker|frame=1}}&lt;br /&gt;
{{Short description|Calcium channel blocker medication}}&lt;br /&gt;
{{Drugbox&lt;br /&gt;
| verifiedrevid = 462260435&lt;br /&gt;
| IUPAC_name = 3,5-dimethyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate&lt;br /&gt;
| imageL = Nifedipine.svg&lt;br /&gt;
| imageR = Nifedipine-from-xtal-3D-balls.png&lt;br /&gt;
| image2 = Nifedipine_substance_photo.jpg&lt;br /&gt;
&amp;lt;!--Clinical data--&amp;gt;&lt;br /&gt;
| tradename = Adalat, Procardia, others&lt;br /&gt;
| Drugs.com = {{drugs.com|monograph|nifedipine}}&lt;br /&gt;
| MedlinePlus = a684028&lt;br /&gt;
| DailyMedID = Nifedipine&lt;br /&gt;
| pregnancy_AU      = C&lt;br /&gt;
| pregnancy_AU_comment = &lt;br /&gt;
| pregnancy_category= &lt;br /&gt;
| legal_status =  &lt;br /&gt;
| routes_of_administration = [[Oral administration|By mouth]], topical&lt;br /&gt;
| class = [[Calcium channel blocker]] ([[dihydropyridine]])&lt;br /&gt;
&amp;lt;!--Pharmacokinetic data--&amp;gt;&lt;br /&gt;
| bioavailability = 45-56%&lt;br /&gt;
| protein_bound = 92-98%&lt;br /&gt;
| metabolism = Gastrointestinal, Liver&lt;br /&gt;
| elimination_half-life = 2 hours&lt;br /&gt;
| excretion = Kidneys: &amp;gt;50%, Biliary: 5-15%&lt;br /&gt;
&amp;lt;!--Identifiers--&amp;gt;&lt;br /&gt;
| CAS_number_Ref = {{cascite|correct|??}}&lt;br /&gt;
| CAS_number = 21829-25-4&lt;br /&gt;
| ATC_prefix = C08&lt;br /&gt;
| ATC_suffix = CA05&lt;br /&gt;
| ATC_supplemental =  &lt;br /&gt;
| PubChem = 4485&lt;br /&gt;
| IUPHAR_ligand = 2514&lt;br /&gt;
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}&lt;br /&gt;
| DrugBank = DB01115&lt;br /&gt;
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}&lt;br /&gt;
| ChemSpiderID = 4330&lt;br /&gt;
| UNII_Ref = {{fdacite|correct|FDA}}&lt;br /&gt;
| UNII = I9ZF7L6G2L&lt;br /&gt;
| KEGG_Ref = {{keggcite|correct|kegg}}&lt;br /&gt;
| KEGG = D00437&lt;br /&gt;
| ChEBI_Ref = {{ebicite|correct|EBI}}&lt;br /&gt;
| ChEBI = 7565&lt;br /&gt;
| ChEMBL_Ref = {{ebicite|correct|EBI}}&lt;br /&gt;
| ChEMBL = 193&lt;br /&gt;
&amp;lt;!--Chemical data--&amp;gt;&lt;br /&gt;
| C=17 | H=18 | N=2 | O=6&lt;br /&gt;
| smiles = O=C(OC)\C1=C(\N/C(=C(/C(=O)OC)C1c2ccccc2[N+]([O-])=O)C)C&lt;br /&gt;
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChI = 1S/C17H18N2O6/c1-9-13(16(20)24-3)15(14(10(2)18-9)17(21)25-4)11-7-5-6-8-12(11)19(22)23/h5-8,15,18H,1-4H3&lt;br /&gt;
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChIKey = HYIMSNHJOBLJNT-UHFFFAOYSA-N&lt;br /&gt;
| melting_point = 173&lt;br /&gt;
}}&lt;br /&gt;
&amp;lt;!-- Definition and medical uses --&amp;gt;&lt;br /&gt;
&amp;#039;&amp;#039;&amp;#039;Nifedipine&amp;#039;&amp;#039;&amp;#039;, sold under the brand names &amp;#039;&amp;#039;&amp;#039;Adalat&amp;#039;&amp;#039;&amp;#039; and &amp;#039;&amp;#039;&amp;#039;Procardia&amp;#039;&amp;#039;&amp;#039; among others, is a [[calcium channel blocker]] medication used to manage [[angina]], [[hypertension|high blood pressure]], [[Raynaud&amp;#039;s phenomenon]], and [[premature labor]]. It is one of the treatments of choice for [[Prinzmetal angina]]. It may be used to treat severe [[high blood pressure in pregnancy]]. Its use in preterm labor may allow more time for [[corticosteroid|steroids]] to improve the baby&amp;#039;s lung function and provide time for transfer of the mother to a well qualified medical facility before delivery. It is a calcium channel blocker of the [[Dihydropyridine calcium channel blockers|dihydropyridine]] type. Nifedipine is taken by mouth and comes in fast- and slow-release formulations.&lt;/div&gt;</summary>
		<author><name>FuzzyBot</name></author>
	</entry>
</feed>