<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3ACalcium_lactate%2F1%2Fja</id>
	<title>Translations:Calcium lactate/1/ja - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Translations%3ACalcium_lactate%2F1%2Fja"/>
	<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Calcium_lactate/1/ja&amp;action=history"/>
	<updated>2026-09-27T17:25:24Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://wiki.tiffa.net/w/index.php?title=Translations:Calcium_lactate/1/ja&amp;diff=141722&amp;oldid=prev</id>
		<title>Fire: Created page with &quot;{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 476998694 | ImageFile =calcium lactate.png | ImageSize =  | PIN =Calcium bis(2-hydroxypropanoate) | OtherNames = {{Unbulleted list   | calcium lactate 5-hydrate   | calcium lactate   | 2-hydroxypropanoic acid   | calcium salt pentahydrate   }} |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 12592 | UNII_Ref = {{fdacite|correct|FDA}}...&quot;</title>
		<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Translations:Calcium_lactate/1/ja&amp;diff=141722&amp;oldid=prev"/>
		<updated>2024-04-21T05:30:05Z</updated>

		<summary type="html">&lt;p&gt;Created page with &amp;quot;{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 476998694 | ImageFile =calcium lactate.png | ImageSize =  | PIN =Calcium bis(2-hydroxypropanoate) | OtherNames = {{Unbulleted list   | calcium lactate 5-hydrate   | calcium lactate   | 2-hydroxypropanoic acid   | calcium salt pentahydrate   }} |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 12592 | UNII_Ref = {{fdacite|correct|FDA}}...&amp;quot;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;{{chembox&lt;br /&gt;
| Verifiedfields = changed&lt;br /&gt;
| Watchedfields = changed&lt;br /&gt;
| verifiedrevid = 476998694&lt;br /&gt;
| ImageFile =calcium lactate.png&lt;br /&gt;
| ImageSize = &lt;br /&gt;
| PIN =Calcium bis(2-hydroxypropanoate)&lt;br /&gt;
| OtherNames = {{Unbulleted list&lt;br /&gt;
  | calcium lactate 5-hydrate&lt;br /&gt;
  | calcium lactate&lt;br /&gt;
  | 2-hydroxypropanoic acid&lt;br /&gt;
  | calcium salt pentahydrate&lt;br /&gt;
  }}&lt;br /&gt;
|Section1={{Chembox Identifiers&lt;br /&gt;
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}&lt;br /&gt;
| ChemSpiderID = 12592&lt;br /&gt;
| UNII_Ref = {{fdacite|correct|FDA}}&lt;br /&gt;
| UNII = 2URQ2N32W3&lt;br /&gt;
| InChI = 1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2&lt;br /&gt;
| InChIKey = MKJXYGKVIBWPFZ-NUQVWONBAM&lt;br /&gt;
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChI = 1S/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2&lt;br /&gt;
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChIKey = MKJXYGKVIBWPFZ-UHFFFAOYSA-L&lt;br /&gt;
| CASNo_Ref = {{cascite|correct|CAS}}&lt;br /&gt;
| CASNo =814-80-2&lt;br /&gt;
| PubChem =13144&lt;br /&gt;
| EC_number = 212-406-7&lt;br /&gt;
| DrugBank = DB13231&lt;br /&gt;
| ChEMBL_Ref = {{ebicite|correct|EBI}}&lt;br /&gt;
| ChEMBL = 2106111&lt;br /&gt;
| SMILES = [Ca+2].[O-]C(=O)C(O)C.[O-]C(=O)C(O)C&lt;br /&gt;
}}&lt;br /&gt;
|Section2={{Chembox Properties&lt;br /&gt;
| Formula =C&amp;lt;sub&amp;gt;6&amp;lt;/sub&amp;gt;H&amp;lt;sub&amp;gt;10&amp;lt;/sub&amp;gt;CaO&amp;lt;sub&amp;gt;6&amp;lt;/sub&amp;gt;&lt;br /&gt;
| MolarMass =218.22 g/mol&lt;br /&gt;
| Appearance = white or off-white powder, slightly [[efflorescent]]&lt;br /&gt;
| Density = 1.494 g/cm&amp;lt;sup&amp;gt;3&amp;lt;/sup&amp;gt;&lt;br /&gt;
| MeltingPtC = 240&lt;br /&gt;
| MeltingPt_notes = (anhydrous) &amp;lt;br&amp;gt; 120 °C (pentahydrate)&lt;br /&gt;
| BoilingPt =&lt;br /&gt;
| Solubility = L-lactate, anhydrous, g/100 mL: 4.8 (10 °C), 5.8 (20 °C), 6.7 (25 °C), 8.5 (30 °C); 7.9 g/100 mL (30 °C)&lt;br /&gt;
| SolubleOther = very soluble in [[methanol]], insoluble in [[ethanol]]&lt;br /&gt;
| pKa = 6.0-8.5&lt;br /&gt;
| RefractIndex = 1.470&lt;br /&gt;
}}&lt;br /&gt;
|Section6={{Chembox Pharmacology&lt;br /&gt;
| ATCCode_prefix = A12&lt;br /&gt;
| ATCCode_suffix = AA05&lt;br /&gt;
}}&lt;br /&gt;
|Section7={{Chembox Hazards&lt;br /&gt;
| GHSPictograms = {{GHS07}}&lt;br /&gt;
| GHSSignalWord = Warning&lt;br /&gt;
| HPhrases = {{H-phrases|319}}&lt;br /&gt;
| PPhrases = {{P-phrases|264|280|305+351+338|337+313}}&lt;br /&gt;
| MainHazards =&lt;br /&gt;
| FlashPt = Not applicable&lt;br /&gt;
| AutoignitionPt = No data&lt;br /&gt;
| NFPA-H = 1&lt;br /&gt;
| NFPA-F = 0&lt;br /&gt;
| NFPA-R = 0&lt;br /&gt;
}}&lt;br /&gt;
}}&lt;/div&gt;</summary>
		<author><name>Fire</name></author>
	</entry>
</feed>