https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3ACalcifediol%2F1%2Fen
Translations:Calcifediol/1/en - Revision history
2026-05-28T21:55:58Z
Revision history for this page on the wiki
MediaWiki 1.43.0
https://wiki.tiffa.net/w/index.php?title=Translations:Calcifediol/1/en&diff=138105&oldid=prev
FuzzyBot: Importing a new version from external source
2024-04-12T11:39:27Z
<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{short description|Chemical compound}}<br />
{{chembox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 480474501<br />
| ImageFile = Calcidiol2.svg<br />
| ImageAlt = Skeletal formula of calcifediol<br />
| ImageFile1 = Calcifediol 3D ball.png<br />
| ImageAlt1 = Ball-and-stick model of the calcifediol molecule<br />
| PIN = (1''S'',3''Z'')-3-[(2''E'')-2-<nowiki/>{(1''R'',3a''S'',7a''R'')-1-[(2''R'')-6-Hydroxy-6-methylheptan-2-yl]-7a-methyloctahydro-4''H''-inden-4-ylidene}ethylidene]-4-methylidenecyclohexan-1-ol<br />
| OtherNames = 25-Hydroxyvitamin D3<br>25-Hydroxycholecalciferol<br>Calcidiol<br />
|Section1={{Chembox Identifiers<br />
| IUPHAR_ligand = 6921<br />
| ChEBI_Ref = {{ebicite|changed|EBI}}<br />
| ChEBI = 17933<br />
| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| ChEMBL = 1222<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = T0WXW8F54E<br />
| KEGG = C01561<br />
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}<br />
| ChemSpiderID = 4446820<br />
| SMILES = O[C@@H]1CC(\C(=C)CC1)=C\C=C2/CCC[C@]3([C@H]2CC[C@@H]3[C@H](C)CCCC(O)(C)C)C<br />
| InChI = 1/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1<br />
| InChIKey = JWUBBDSIWDLEOM-DTOXIADCBI<br />
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChI = 1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1<br />
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChIKey = JWUBBDSIWDLEOM-DTOXIADCSA-N<br />
| CASNo_Ref = {{cascite|correct|CAS}}<br />
| CASNo = 19356-17-3<br />
| PubChem = 5283731<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| DrugBank = DB00146<br />
| MeSHName = Calcifediol<br />
}}<br />
|Section2={{Chembox Properties<br />
| Formula = C<sub>27</sub>H<sub>44</sub>O<sub>2</sub><br />
| MolarMass = 400.64 g/mol<br />
| Appearance = <br />
| Density = <br />
| MeltingPt = <br />
| BoilingPt = <br />
}}<br />
| Section6 = {{Chembox Pharmacology<br />
| Pharmacology_ref = <br />
| ATCCode_prefix = H05<br />
| ATCCode_suffix = BX05 <!-- Oral formulations only indicated in treatment of renal secondary hyperparathyroidism --><br />
| ATC_Supplemental = <br />
| ATCvet = <br />
| Licence_EU = <br />
| INN = <br />
| INN_EMA = <br />
| Licence_US = <br />
| Legal_status = <br />
| Legal_AU = <br />
| Legal_AU_comment = <br />
| Legal_CA = <br />
| Legal_CA_comment = <br />
| Legal_NZ = <br />
| Legal_NZ_comment = <br />
| Legal_UK = <br />
| Legal_UK_comment = <br />
| Legal_US = <br />
| Legal_US_comment = <br />
| Legal_EU = <br />
| Legal_EU_comment = <br />
| Legal_UN = <br />
| Legal_UN_comment = <br />
| Pregnancy_category = <br />
| Pregnancy_AU = <br />
| Pregnancy_AU_comment = <br />
| Dependence_liability = <br />
| AdminRoutes = <br />
| Bioavail = <br />
| ProteinBound = <br />
| Metabolism = <br />
| Metabolites = <br />
| OnsetOfAction = <br />
| HalfLife = <br />
| DurationOfAction = <br />
| Excretion = <br />
}}<br />
|Section7={{Chembox Hazards<br />
| MainHazards = <br />
| FlashPt = <br />
| AutoignitionPt = <br />
}}<br />
}}<br />
'''Calcifediol''', also known as '''calcidiol''', '''25-hydroxycholecalciferol''', or '''25-hydroxyvitamin D<sub>3</sub>''' (abbreviated '''25(OH)D<sub>3</sub>'''), is a form of [[vitamin D]] produced in the [[liver]] by [[hydroxylation]] of [[vitamin D3|vitamin D<sub>3</sub>]] (cholecalciferol) by the enzyme [[vitamin D 25-hydroxylase]]. Calcifediol can be further hydroxylated by the [[enzyme]] [[25-Hydroxyvitamin D3 1-alpha-hydroxylase|25(OH)D-1α-hydroxylase]], primarily in the kidney, to form [[calcitriol]] (1,25-(OH)<sub>2</sub>D<sub>3</sub>), which is the active hormonal form of vitamin D.</div>
FuzzyBot