https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3ABiotin%2F1%2Fen
Translations:Biotin/1/en - Revision history
2026-05-12T08:41:00Z
Revision history for this page on the wiki
MediaWiki 1.43.0
https://wiki.tiffa.net/w/index.php?title=Translations:Biotin/1/en&diff=134571&oldid=prev
FuzzyBot: Importing a new version from external source
2024-04-04T07:25:25Z
<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{Short description|Chemical compound (vitamin B7)}}<br />
{{chembox<br />
| Watchedfields = changed<br />
| verifiedrevid = 443307462<br />
| Name = Biotin<br />
| Reference =<br />
| ImageFile = Biotin_structure.svg<br />
| ImageSize = 220<br />
| ImageAlt = Skeletal formula of biotin<br />
| ImageFile1 = Biotin-view-1-from-xtal-Mercury-3D-balls.png<br />
| ImageSize1 = 150<br />
| ImageAlt1 = Ball-and-stick model of the Biotin molecule<br />
| PIN =5-[(3a''S'',4''S'',6a''R'')-2-Oxohexahydro-1''H''-thieno[3,4-''d'']imidazol-4-yl]pentanoic acid<br />
| OtherNames = Vitamin B<sub>7</sub><br />
|Section1={{Chembox Identifiers<br />
| IUPHAR_ligand = 4787<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| DrugBank = DB00121<br />
| ChEBI_Ref = {{ebicite|correct|EBI}}<br />
| ChEBI = 15956<br />
| SMILES = O=C1N[C@@H]2[C@@H](SC[C@@H]2N1)CCCCC(=O)O<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = 6SO6U10H04<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| KEGG = D00029<br />
| InChI = 1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1<br />
| InChIKey = YBJHBAHKTGYVGT-ZKWXMUAHBB<br />
| SMILES1 = C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2<br />
| ChEMBL_Ref = {{ebicite|correct|EBI}}<br />
| ChEMBL = 857<br />
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChI = 1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1<br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = YBJHBAHKTGYVGT-ZKWXMUAHSA-N<br />
| CASNo = 58-85-5<br />
| CASNo_Ref = {{cascite|correct|CAS}}<br />
| PubChem = 171548<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| ChemSpiderID = 149962<br />
| RTECS =<br />
}}<br />
|Section2={{Chembox Properties<br />
| C=10 | H=16 | N=2 | O=3 | S=1<br />
| Appearance = White crystalline needles<br />
| Solubility = 22 mg/100 mL<br />
| MeltingPtC = 232 to 233<br />
| MeltingPt_notes = <br />
}}<br />
|Section6={{Chembox Pharmacology<br />
| ATCCode_prefix = A11<br />
| ATCCode_suffix = HA05<br />
}}<br />
|Section7={{Chembox Hazards<br />
| NFPA-H = 1<br />
| NFPA-F = 1<br />
| NFPA-R = 0<br />
}}<br />
}}<br />
'''Biotin''' (also known as '''vitamin B<sub>7</sub>''' or '''vitamin H''') is one of the [[B vitamins]]. It is involved in a wide range of metabolic processes, both in humans and in other organisms, primarily related to the utilization of fats, carbohydrates, and amino acids. The name ''biotin'', borrowed from the German {{Lang|de|Biotin}}, derives from the Ancient Greek word {{lang|grc|{{linktext|βίοτος}}}} ({{Transliteration|grc|bíotos}}; 'life') and the suffix "-in" (a suffix used in chemistry usually to indicate 'forming'). Biotin appears as a white crystalline solid that looks like needles.</div>
FuzzyBot