https://wiki.tiffa.net/w/index.php?action=history&feed=atom&title=Translations%3A7-Dehydrocholesterol%2F1%2FenTranslations:7-Dehydrocholesterol/1/en - Revision history2026-05-11T18:18:30ZRevision history for this page on the wikiMediaWiki 1.43.0https://wiki.tiffa.net/w/index.php?title=Translations:7-Dehydrocholesterol/1/en&diff=137400&oldid=prevFuzzyBot: Importing a new version from external source2024-04-11T10:05:53Z<p>Importing a new version from external source</p>
<p><b>New page</b></p><div>{{chembox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 477226494<br />
| ImageFile = 7-Dehydrocholesterol.svg<br />
| ImageSize = 220<br />
| ImageFile1 = 7-Dehydrocholesterol molecule ball.png<br />
| ImageSize1 = 250<br />
| ImageAlt1 = Ball-and-stick model of 7-dehydrocholesterol<br />
| IUPACName = Cholesta-5,7-dien-3β-ol<br />
| SystematicName = (1''R'',3a''R'',7''S'',9a''R'',9b''S'',11a''R'')-9a,11a-Dimethyl-1-[(2''R'')-6-methylheptan-2-yl]-2,3,3a,6,7,8,9,9a,9b,10,11,11a-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-7-ol<br />
| OtherNames = <br />
| Section1 = {{Chembox Identifiers<br />
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}<br />
| ChemSpiderID = 388534<br />
| InChI = 1/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,18-19,21,23-25,28H,6-8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1<br />
| InChIKey = UCTLRSWJYQTBFZ-DDPQNLDTBZ<br />
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChI = 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,18-19,21,23-25,28H,6-8,11-17H2,1-5H3/t19-,21+,23-,24+,25+,26+,27-/m1/s1-dehydrocholesterol <br />
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}<br />
| StdInChIKey = UCTLRSWJYQTBFZ-DDPQNLDTSA-N<br />
| CASNo_Ref = {{cascite|correct|CAS}}<br />
| CASNo = 434-16-2<br />
| PubChem = 172<br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = BK1IU07GKF<br />
| ChEBI_Ref = {{ebicite|correct|EBI}}<br />
| ChEBI = 17759<br />
| SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4<br />
| MeSHName = 7-dehydrocholesterol<br />
}}<br />
| Section2 = {{Chembox Properties<br />
| Formula = C<sub>27</sub>H<sub>44</sub>O<br />
| MolarMass = 384.638<br />
| Appearance = <br />
| Density = <br />
| MeltingPt = <br />
| BoilingPt = <br />
}}<br />
| Section3 = {{Chembox Hazards<br />
| MainHazards = <br />
| FlashPt = <br />
| AutoignitionPt = <br />
}}<br />
}}<br />
[[Image:Skinlayers.png|thumb|250px|right|The epidermal strata of the skin.]] <br />
'''7-Dehydrocholesterol''' ('''7-DHC''') is a [[zoosterol]] that functions in the [[blood plasma|serum]] as a [[cholesterol]] precursor, and is [[photochemically]] converted to [[Cholecalciferol|vitamin D<sub>3</sub>]] in the [[skin]], therefore functioning as [[provitamin]]-D<sub>3</sub>. The presence of this compound in human skin enables humans to manufacture vitamin D<sub>3</sub> ([[cholecalciferol]]). Upon exposure to [[ultraviolet]] UV-B rays in the sun light, 7-DHC is converted into vitamin D<sub>3</sub> via [[Previtamin D3|previtamin D<sub>3</sub>]] as an intermediate [[isomer]]. It is also found in the [[milk]] of several mammalian species. [[Lanolin]], a waxy substance that is naturally secreted by wool-bearing mammals, contains 7-DHC which is converted into vitamin D by sunlight and then ingested during grooming as a nutrient. In insects 7-dehydrocholesterol is a precursor for the hormone [[ecdysone]], required for reaching adulthood. It was discovered by Nobel-laureate organic chemist [[Adolf Windaus]].</div>FuzzyBot