<?xml version="1.0"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
	<id>https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Thiamine_pyrophosphate%2Fen</id>
	<title>Thiamine pyrophosphate/en - Revision history</title>
	<link rel="self" type="application/atom+xml" href="https://wiki.tiffa.net/w/index.php?action=history&amp;feed=atom&amp;title=Thiamine_pyrophosphate%2Fen"/>
	<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Thiamine_pyrophosphate/en&amp;action=history"/>
	<updated>2026-08-29T08:43:27Z</updated>
	<subtitle>Revision history for this page on the wiki</subtitle>
	<generator>MediaWiki 1.43.0</generator>
	<entry>
		<id>https://wiki.tiffa.net/w/index.php?title=Thiamine_pyrophosphate/en&amp;diff=136696&amp;oldid=prev</id>
		<title>FuzzyBot: Updating to match new version of source page</title>
		<link rel="alternate" type="text/html" href="https://wiki.tiffa.net/w/index.php?title=Thiamine_pyrophosphate/en&amp;diff=136696&amp;oldid=prev"/>
		<updated>2024-04-10T05:55:20Z</updated>

		<summary type="html">&lt;p&gt;Updating to match new version of source page&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;&amp;lt;languages /&amp;gt;&lt;br /&gt;
{{chembox&lt;br /&gt;
| Watchedfields  = changed&lt;br /&gt;
| verifiedrevid  = 470606241&lt;br /&gt;
| Name           = &lt;br /&gt;
| ImageFile      = Thiamine diphosphate.png&lt;br /&gt;
| ImageSize      = 200px&lt;br /&gt;
| IUPACName      = 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate&lt;br /&gt;
| OtherNames     = Thiamine diphosphate&lt;br /&gt;
| SystematicName = &lt;br /&gt;
| Section1       = {{Chembox Identifiers&lt;br /&gt;
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}&lt;br /&gt;
| ChemSpiderID = 10670483&lt;br /&gt;
| ChEBI = 9532&lt;br /&gt;
| KEGG = C00068&lt;br /&gt;
| UNII_Ref = {{fdacite|correct|FDA}}&lt;br /&gt;
| UNII = Q57971654Y&lt;br /&gt;
| InChI = 1/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1&lt;br /&gt;
| InChIKey = NBSUTVXQOGUTJX-REWHXWOFAB&lt;br /&gt;
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChI = 1S/C12H17N4OS.ClH.H4O7P2/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;1-8(2,3)7-9(4,5)6/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H;(H2,1,2,3)(H2,4,5,6)/q+1;;/p-1&lt;br /&gt;
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}&lt;br /&gt;
| StdInChIKey = NBSUTVXQOGUTJX-UHFFFAOYSA-M&lt;br /&gt;
| CASNo_Ref = {{cascite|correct|CAS}}&lt;br /&gt;
| CASNo = 136-08-3&lt;br /&gt;
| PubChem = 1132&lt;br /&gt;
| SMILES = Cc2ncc(C[n+]1csc(CCOP(=O)(O)OP(=O)(O)O)c1C)c(N)n2&lt;br /&gt;
| MeSHName = Thiamine+pyrophosphate&lt;br /&gt;
  }}&lt;br /&gt;
| Section2       = {{Chembox Properties&lt;br /&gt;
| Formula = C&amp;lt;sub&amp;gt;12&amp;lt;/sub&amp;gt;H&amp;lt;sub&amp;gt;19&amp;lt;/sub&amp;gt;N&amp;lt;sub&amp;gt;4&amp;lt;/sub&amp;gt;O&amp;lt;sub&amp;gt;7&amp;lt;/sub&amp;gt;P&amp;lt;sub&amp;gt;2&amp;lt;/sub&amp;gt;S&amp;lt;sup&amp;gt;+&amp;lt;/sup&amp;gt;&lt;br /&gt;
| MolarMass = 425.314382  g/mol&lt;br /&gt;
| Appearance = &lt;br /&gt;
| Density = &lt;br /&gt;
| MeltingPt = &lt;br /&gt;
| BoilingPt = &lt;br /&gt;
  }}&lt;br /&gt;
| Section3       = {{Chembox Hazards&lt;br /&gt;
| MainHazards = &lt;br /&gt;
| FlashPt = &lt;br /&gt;
| AutoignitionPt = &lt;br /&gt;
  }}&lt;br /&gt;
| Section4       = &lt;br /&gt;
| Section5       = &lt;br /&gt;
| Section6       = &lt;br /&gt;
}}&lt;br /&gt;
&amp;#039;&amp;#039;&amp;#039;Thiamine pyrophosphate&amp;#039;&amp;#039;&amp;#039; (&amp;#039;&amp;#039;&amp;#039;TPP&amp;#039;&amp;#039;&amp;#039; or &amp;#039;&amp;#039;&amp;#039;ThPP&amp;#039;&amp;#039;&amp;#039;), or &amp;#039;&amp;#039;&amp;#039;thiamine diphosphate&amp;#039;&amp;#039;&amp;#039; (&amp;#039;&amp;#039;&amp;#039;ThDP&amp;#039;&amp;#039;&amp;#039;), or &amp;#039;&amp;#039;&amp;#039;cocarboxylase&amp;#039;&amp;#039;&amp;#039; is a [[thiamine]] (vitamin B&amp;lt;sub&amp;gt;1&amp;lt;/sub&amp;gt;) [[Derivative (chemistry)|derivative]] which is produced by the [[enzyme]] [[thiamine diphosphokinase]]. Thiamine pyrophosphate is a [[cofactor (biochemistry)|cofactor]] that is present in all living systems, in which it catalyzes several [[Biochemistry|biochemical]] reactions.&lt;br /&gt;
&lt;br /&gt;
Thiamine pyrophosphate is synthesized in the [[cytosol]] and is required in the cytosol for the activity of transketolase and in the mitochondria for the activity of pyruvate-, oxoglutarate- and branched chain keto acid dehydrogenases. To date, the yeast ThPP carrier (Tpc1p) the human Tpc and the &amp;#039;&amp;#039;[[Drosophila melanogaster]]&amp;#039;&amp;#039; have been identified as being responsible for the mitochondrial transport of ThPP and ThMP. It was first discovered as an [[essential nutrient]] ([[vitamin]]) in humans through its link with the [[peripheral nervous system]] [[disease]] [[beriberi]], which results from a deficiency of thiamine in the [[Diet (nutrition)|diet]].&lt;br /&gt;
&lt;br /&gt;
TPP works as a [[coenzyme]] in many enzymatic reactions, such as:&lt;br /&gt;
&lt;br /&gt;
* [[Pyruvate dehydrogenase]] complex&lt;br /&gt;
* [[Pyruvate decarboxylase]] in [[ethanol fermentation]]&lt;br /&gt;
* [[Alpha-ketoglutarate dehydrogenase]] complex&lt;br /&gt;
* [[Branched-chain amino acid dehydrogenase]] complex&lt;br /&gt;
* [[2-hydroxyphytanoyl-CoA lyase]] &lt;br /&gt;
* [[Transketolase]]&lt;br /&gt;
&lt;br /&gt;
==Chemistry==&lt;br /&gt;
[[Image:TPP-ylide.svg|thumb|right|The &amp;quot;ylide form&amp;quot; of TPP.]]&lt;br /&gt;
&lt;br /&gt;
Chemically, TPP consists of a [[pyrimidine]] ring which is connected to a [[thiazole]] ring, which is in turn connected to a [[pyrophosphate]] (diphosphate) [[functional group]].&lt;br /&gt;
&lt;br /&gt;
The part of TPP molecule that is most commonly involved in reactions is the thiazole ring, which contains [[nitrogen]] and [[sulfur]]. Thus, the thiazole ring is the &amp;quot;reagent portion&amp;quot; of the molecule. The C2 of this ring is capable of acting as an [[acid]] by donating its [[proton]] and forming a [[carbanion]]. Normally, reactions that form carbanions are highly unfavorable, but the positive charge on the tetravalent nitrogen just adjacent to the carbanion stabilizes the negative charge, making the reaction much more favorable. A compound with positive and negative charges on adjacent atoms is called an [[ylide]], so sometimes the carbanion form of TPP is referred to as the &amp;quot;ylide form&amp;quot;.&lt;br /&gt;
&lt;br /&gt;
==Reaction mechanisms==&lt;br /&gt;
In several reactions, including that of pyruvate dehydrogenase, alpha-ketoglutarate dehydrogenase, and transketolase, TPP catalyses the reversible decarboxylation reaction (aka cleavage of a substrate compound at a carbon-carbon bond connecting a [[carbonyl group]] to an adjacent reactive group—usually a [[carboxylic acid]] or an [[Alcohol (chemistry)|alcohol]]). It achieves this in four basic steps:&lt;br /&gt;
&lt;br /&gt;
#The carbanion of the TPP ylid [[nucleophilic attack|nucleophilically attacks]] the carbonyl group on the substrate.  (This forms a single bond between the TPP and the substrate.)&lt;br /&gt;
#The target bond on the substrate is broken, and its electrons are pushed towards the TPP.  This creates a double bond between the substrate carbon and the TPP carbon and pushes the electrons in the N-C double bond in TPP entirely onto the nitrogen atom, reducing it from a positive to neutral form.&lt;br /&gt;
#In what is essentially the reverse of step two, the electrons push back in the opposite direction forming a new bond between the substrate carbon and another atom.  (In the case of the decarboxylases, this creates a new carbon-hydrogen bond.  In the case of transketolase, this attacks a new substrate molecule to form a new carbon-carbon bond.)&lt;br /&gt;
#In what is essentially the reverse of step one, the TPP-substrate bond is broken, reforming the TPP ylid and the substrate carbonyl.&lt;br /&gt;
  &lt;br /&gt;
[[File:TPP Mechanism.svg|TPP Mechanism]]&lt;br /&gt;
&lt;br /&gt;
&amp;lt;gallery mode=packed style=&amp;quot;text-align:left&amp;quot;&amp;gt;&lt;br /&gt;
Image:TPP_thiazolium.svg|The TPP thiazolium ring can be deprotonated at C2 to become an ylid.&lt;br /&gt;
Image:Thiamine pyrophosphate ng.png|A full view of TPP.  The arrow indicates the acidic proton.&lt;br /&gt;
&amp;lt;/gallery&amp;gt;&lt;br /&gt;
&lt;br /&gt;
==See also==&lt;br /&gt;
* [[TPP riboswitch]]&lt;br /&gt;
&lt;br /&gt;
==External links==&lt;br /&gt;
*[http://www.uic.edu/classes/phar/phar332/Clinical_Cases/vitamin%20cases/thiamin/thiamin_pyrophosphate.htm UIC.edu]&lt;br /&gt;
&lt;br /&gt;
{{Enzyme cofactors}}&lt;br /&gt;
&lt;br /&gt;
{{二次利用|date=3 November 2023}}&lt;br /&gt;
[[Category:Cofactors]]&lt;br /&gt;
[[Category:Organophosphates]]&lt;br /&gt;
[[Category:Thiazoles]]&lt;br /&gt;
[[Category:Pyrimidines]]&lt;br /&gt;
[[Category:Thiamine]]&lt;br /&gt;
[[Category:Pyrophosphates]]&lt;/div&gt;</summary>
		<author><name>FuzzyBot</name></author>
	</entry>
</feed>