Previtamin D3 - Revision history

Fire: Marked this version for translation

2024-04-11T10:23:27Z

Marked this version for translation

← Older revision		Revision as of 19:23, 11 April 2024
Line 1:		Line 1:
	<languages />		<languages />
	<translate>		<translate>
			<!--T:1-->
	{{DISPLAYTITLE:Previtamin D<sub>3</sub>}}		{{DISPLAYTITLE:Previtamin D<sub>3</sub>}}
	{{Chembox		{{Chembox
Line 53:		Line 54:
	'''Previtamin D<sub>3</sub>''' is an intermediate in the production of [[cholecalciferol]] ([[vitamin D]]<sub>3</sub>).		'''Previtamin D<sub>3</sub>''' is an intermediate in the production of [[cholecalciferol]] ([[vitamin D]]<sub>3</sub>).

			<!--T:2-->
	It is formed by the action of [[UV light]], most specifically UVB light of wavelengths between 295 and 300 nm, acting on [[7-dehydrocholesterol]] in the [[epidermis_(skin)\|epidermal layers]] of the skin.		It is formed by the action of [[UV light]], most specifically UVB light of wavelengths between 295 and 300 nm, acting on [[7-dehydrocholesterol]] in the [[epidermis_(skin)\|epidermal layers]] of the skin.

			<!--T:3-->
	The B ring of the [[steroid]] nucleus structure is broken open, making a [[secosteroid]]. This then undergoes spontaneous [[isomerization]] into cholecalciferol, the [[prohormone]] of the active form of vitamin D, [[calcitriol]].		The B ring of the [[steroid]] nucleus structure is broken open, making a [[secosteroid]]. This then undergoes spontaneous [[isomerization]] into cholecalciferol, the [[prohormone]] of the active form of vitamin D, [[calcitriol]].

			<!--T:4-->
	The synthesis of previtamin D<sub>3</sub> is blocked effectively by [[sunscreens]].		The synthesis of previtamin D<sub>3</sub> is blocked effectively by [[sunscreens]].

			<!--T:5-->
	== Interactive pathway map==		== Interactive pathway map==
	{{VitaminDSynthesis_WP1531\|highlight=Previtamin_D3}}		{{VitaminDSynthesis_WP1531\|highlight=Previtamin_D3}}

			<!--T:6-->
	{{Vitamin}}		{{Vitamin}}

			<!--T:7-->
	{{二次利用\|date=20 November 2023}}		{{二次利用\|date=20 November 2023}}
	[[Category:Vitamin D]]		[[Category:Vitamin D]]

Fire at 10:23, 11 April 2024

2024-04-11T10:23:13Z

← Older revision		Revision as of 19:23, 11 April 2024
Line 1:		Line 1:
			<languages />
			<translate>
	{{DISPLAYTITLE:Previtamin D<sub>3</sub>}}		{{DISPLAYTITLE:Previtamin D<sub>3</sub>}}
	{{Chembox		{{Chembox
Line 66:		Line 68:
	[[Category:Secosteroids]]		[[Category:Secosteroids]]
	[[Category:Indanes]]		[[Category:Indanes]]
			</translate>

Fire: Created page with "{{DISPLAYTITLE:Previtamin D₃}} {{Chembox | Name = Previtamin D₃ | ImageFile = Previtamin D3.svg | ImageFile_Ref = {{Chemboximage|correct|??}} | ImageName = Stereo skeletal formula of previtamin D₃ ((1R)-1-ol, (Z)-en, (1R,3aR,7aR)-7a-meth,-1-hept,-3a-hydro, (2R)-2-yl) | IUPACName = (3''S'',6''Z'')-9,10-Secocholesta-5(10),6,8-trien-3-ol | SystematicName = (1''S'')-4-Methyl-3-[(''Z'')-2-{(1''R'',3a''R'',7a''R'')-7a-methyl-1-[(2''R''..."

2024-04-11T10:19:34Z

Created page with "{{DISPLAYTITLE:Previtamin D3}} {{Chembox | Name = Previtamin D3 | ImageFile = Previtamin D3.svg | ImageFile_Ref = {{Chemboximage|correct|??}} | ImageName = Stereo skeletal formula of previtamin D3 ((1R)-1-ol, (Z)-en, (1R,3aR,7aR)-7a-meth,-1-hept,-3a-hydro, (2R)-2-yl) | IUPACName = (3''S'',6''Z'')-9,10-Secocholesta-5(10),6,8-trien-3-ol | SystematicName = (1''S'')-4-Methyl-3-[(''Z'')-2-<nowiki/>{(1''R'',3a''R'',7a''R'')-7a-methyl-1-[(2''R''..."

New page

{{DISPLAYTITLE:Previtamin D3}}
{{Chembox
| Name = Previtamin D3
| ImageFile = Previtamin D3.svg
| ImageFile_Ref = {{Chemboximage|correct|??}}
| ImageName = Stereo skeletal formula of previtamin D3 ((1R)-1-ol, (Z)-en, (1R,3aR,7aR)-7a-meth,-1-hept,-3a-hydro, (2R)-2-yl)
| IUPACName = (3''S'',6''Z'')-9,10-Secocholesta-5(10),6,8-trien-3-ol
| SystematicName = (1''S'')-4-Methyl-3-[(''Z'')-2-<nowiki/>{(1''R'',3a''R'',7a''R'')-7a-methyl-1-[(2''R'')-6-methylheptan-2-yl]-2,3,3a,6,7,7a-hexahydro-1''H''-inden-4-yl}ethen-1-yl]cyclohex-3-en-1-ol
| OtherNames = Previtamin D3
|Section1={{Chembox Identifiers
| CASNo = 1173-13-3
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 17592-07-3
| CASNo1_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HDA46400N5
| UNII1_Ref = {{fdacite|correct|FDA}}
| UNII1 = 6RR0I9PK8W
| PubChem = 86590
| PubChem1 = 6178113
| PubChem1_Comment = (''E'')-en
| PubChem2 = 25245851
| PubChem2_Comment = (1''S'')-1-ol, (''Z'')-en, (2''R'')-2-yl
| PubChem3 = 11485943
| PubChem3_Comment = (1''S'')-1-ol, (''E'')-en, (1''R'',7a''R'')-7a-meth,-1-hept, (2''R'')-2-yl
| PubChem4 = 11199982
| PubChem4_Comment = (1''S'')-1-ol, (''Z'')-en, (1''R'',7a''R'')-7a-meth,-1-hept, (2''R'')-2-yl
| ChemSpiderID = 78098
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 4832524
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Comment = (''E'')-en
| ChemSpiderID2 = 9660762
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2_Comment = (1''S'')-1-ol, (''E'')-en, (1''R'',7a''R'')-7a-meth,-1-hept, (2''R'')-2-yl
| ChemSpiderID3 = 9375051
| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID3_Comment = (1''S'')-1-ol, (''Z'')-en, (1''R'',7a''R'')-7a-meth,-1-hept, (2''R'')-2-yl
| EINECS = 241-561-3
| MeSHName = Previtamin+D(3)
| SMILES = CC(C)CCCC(C)C1CCC2C(C=CC3=C(C)CCC(O)C3)=CCCC12C
| StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h10,12-13,19,21,24-26,28H,6-9,11,14-18H2,1-5H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YUGCAAVRZWBXEQ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=27 | H=44 | O=1
}}
}}
'''Previtamin D3''' is an intermediate in the production of [[cholecalciferol]] ([[vitamin D]]3).

It is formed by the action of [[UV light]], most specifically UVB light of wavelengths between 295 and 300 nm, acting on [[7-dehydrocholesterol]] in the [[epidermis_(skin)|epidermal layers]] of the skin.

The B ring of the [[steroid]] nucleus structure is broken open, making a [[secosteroid]]. This then undergoes spontaneous [[isomerization]] into cholecalciferol, the [[prohormone]] of the active form of vitamin D, [[calcitriol]].

The synthesis of previtamin D3 is blocked effectively by [[sunscreens]].

== Interactive pathway map==
{{VitaminDSynthesis_WP1531|highlight=Previtamin_D3}}

{{Vitamin}}

{{二次利用|date=20 November 2023}}
[[Category:Vitamin D]]
[[Category:Secosteroids]]
[[Category:Indanes]]